About 6-(1,3-dioxolan-2-yl)hex-1-ene-3,4-dione
6-(1,3-dioxolan-2-yl)hex-1-ene-3,4-dione (PubChem CID 70012430) has the molecular formula C9H12O4
and a molecular weight of 184.19 g/mol. Its IUPAC name is 6-(1,3-dioxolan-2-yl)hex-1-ene-3,4-dione.
Molecular Properties
| Compound Name | 6-(1,3-dioxolan-2-yl)hex-1-ene-3,4-dione |
| PubChem CID | 70012430 |
| Molecular Formula | C9H12O4 |
| Molecular Weight | 184.19 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | 6-(1,3-dioxolan-2-yl)hex-1-ene-3,4-dione |
| SMILES | C=CC(=O)C(=O)CCC1OCCO1 |
| InChI | InChI=1S/C9H12O4/c1-2-7(10)8(11)3-4-9-12-5-6-13-9/h2,9H,1,3-6H2 |
| InChIKey | WGUBHMIWSYOTFE-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.19 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 6-(1,3-dioxolan-2-yl)hex-1-ene-3,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(1,3-dioxolan-2-yl)hex-1-ene-3,4-dione?
The IUPAC name of 6-(1,3-dioxolan-2-yl)hex-1-ene-3,4-dione (CID 70012430) is 6-(1,3-dioxolan-2-yl)hex-1-ene-3,4-dione.
What is the SMILES notation for 6-(1,3-dioxolan-2-yl)hex-1-ene-3,4-dione?
The canonical SMILES for 6-(1,3-dioxolan-2-yl)hex-1-ene-3,4-dione is C=CC(=O)C(=O)CCC1OCCO1.
What is the InChIKey of 6-(1,3-dioxolan-2-yl)hex-1-ene-3,4-dione?
The InChIKey is WGUBHMIWSYOTFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O4/c1-2-7(10)8(11)3-4-9-12-5-6-13-9/h2,9H,1,3-6H2.
What are the key properties of 6-(1,3-dioxolan-2-yl)hex-1-ene-3,4-dione?
6-(1,3-dioxolan-2-yl)hex-1-ene-3,4-dione has a molecular weight of 184.19 g/mol, XLogP of 0.46, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(1,3-dioxolan-2-yl)hex-1-ene-3,4-dione is sourced from PubChem (CID 70012430), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).