C10H13ClN2OS — CID 70012457
3-methyl-4-(pyridin-2-ylmethylsulfanyl)azetidin-2-one;hydrochloride (PubChem CID 70012457) has the molecular formula C10H13ClN2OS and a molecular weight of 244.75 g/mol. Its IUPAC name is 3-methyl-4-(pyridin-2-ylmethylsulfanyl)azetidin-2-one;hydrochloride.
| Compound Name | 3-methyl-4-(pyridin-2-ylmethylsulfanyl)azetidin-2-one;hydrochloride |
|---|---|
| PubChem CID | 70012457 |
| Molecular Formula | C10H13ClN2OS |
| Molecular Weight | 244.75 g/mol |
| Exact Mass | 244.04 |
| IUPAC Name | 3-methyl-4-(pyridin-2-ylmethylsulfanyl)azetidin-2-one;hydrochloride |
| SMILES | CC1C(=O)NC1SCc1ccccn1.Cl |
| InChI | InChI=1S/C10H12N2OS.ClH/c1-7-9(13)12-10(7)14-6-8-4-2-3-5-11-8;/h2-5,7,10H,6H2,1H3,(H,12,13);1H |
| InChIKey | TUMAASPCGMSTOF-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.75 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |