About 1-[4-chloro-6-(phenyliminomethyl)-2-pyridinyl]-N-phenylmethanimine;iron(3+);trichloride
1-[4-chloro-6-(phenyliminomethyl)-2-pyridinyl]-N-phenylmethanimine;iron(3+);trichloride (PubChem CID 70012907) has the molecular formula C19H14Cl4FeN3
and a molecular weight of 482.00 g/mol. Its IUPAC name is 1-[4-chloro-6-(phenyliminomethyl)-2-pyridinyl]-N-phenylmethanimine;iron(3+);trichloride.
Molecular Properties
| Compound Name | 1-[4-chloro-6-(phenyliminomethyl)-2-pyridinyl]-N-phenylmethanimine;iron(3+);trichloride |
| PubChem CID | 70012907 |
| Molecular Formula | C19H14Cl4FeN3 |
| Molecular Weight | 482.00 g/mol |
| Exact Mass | 479.93 |
| IUPAC Name | 1-[4-chloro-6-(phenyliminomethyl)-2-pyridinyl]-N-phenylmethanimine;iron(3+);trichloride |
| SMILES | Clc1cc(/C=N/c2ccccc2)nc(/C=N/c2ccccc2)c1.[Cl-].[Cl-].[Cl-].[Fe+3] |
| InChI | InChI=1S/C19H14ClN3.3ClH.Fe/c20-15-11-18(13-21-16-7-3-1-4-8-16)23-19(12-15)14-22-17-9-5-2-6-10-17;;;;/h1-14H;3*1H;/q;;;;+3/p-3/b21-13+,22-14+;;;; |
| InChIKey | CWVZXIHQMKCBLI-YSVHZKDNSA-K |
| XLogP | -3.75 |
| TPSA | 37.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 482.00 |
| LogP ≤ 5 | -3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 1-[4-chloro-6-(phenyliminomethyl)-2-pyridinyl]-N-phenylmethanimine;iron(3+);trichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-chloro-6-(phenyliminomethyl)-2-pyridinyl]-N-phenylmethanimine;iron(3+);trichloride?
The IUPAC name of 1-[4-chloro-6-(phenyliminomethyl)-2-pyridinyl]-N-phenylmethanimine;iron(3+);trichloride (CID 70012907) is 1-[4-chloro-6-(phenyliminomethyl)-2-pyridinyl]-N-phenylmethanimine;iron(3+);trichloride.
What is the SMILES notation for 1-[4-chloro-6-(phenyliminomethyl)-2-pyridinyl]-N-phenylmethanimine;iron(3+);trichloride?
The canonical SMILES for 1-[4-chloro-6-(phenyliminomethyl)-2-pyridinyl]-N-phenylmethanimine;iron(3+);trichloride is Clc1cc(/C=N/c2ccccc2)nc(/C=N/c2ccccc2)c1.[Cl-].[Cl-].[Cl-].[Fe+3].
What is the InChIKey of 1-[4-chloro-6-(phenyliminomethyl)-2-pyridinyl]-N-phenylmethanimine;iron(3+);trichloride?
The InChIKey is CWVZXIHQMKCBLI-YSVHZKDNSA-K. The full InChI is InChI=1S/C19H14ClN3.3ClH.Fe/c20-15-11-18(13-21-16-7-3-1-4-8-16)23-19(12-15)14-22-17-9-5-2-6-10-17;;;;/h1-14H;3*1H;/q;;;;+3/p-3/b21-13+,22-14+;;;;.
What are the key properties of 1-[4-chloro-6-(phenyliminomethyl)-2-pyridinyl]-N-phenylmethanimine;iron(3+);trichloride?
1-[4-chloro-6-(phenyliminomethyl)-2-pyridinyl]-N-phenylmethanimine;iron(3+);trichloride has a molecular weight of 482.00 g/mol, XLogP of -3.75, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-chloro-6-(phenyliminomethyl)-2-pyridinyl]-N-phenylmethanimine;iron(3+);trichloride is sourced from PubChem (CID 70012907), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).