C18H17F3N2O5 — CID 70012975
6-(5,6-dihydroxy-4,7-dimethyl-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-2-yl)-6-(trifluoromethyl)cyclohexa-2,4-diene-1-carbonitrile (PubChem CID 70012975) has the molecular formula C18H17F3N2O5 and a molecular weight of 398.34 g/mol. Its IUPAC name is 6-(5,6-dihydroxy-4,7-dimethyl-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-2-yl)-6-(trifluoromethyl)cyclohexa-2,4-diene-1-carbonitrile.
| Compound Name | 6-(5,6-dihydroxy-4,7-dimethyl-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-2-yl)-6-(trifluoromethyl)cyclohexa-2,4-diene-1-carbonitrile |
|---|---|
| PubChem CID | 70012975 |
| Molecular Formula | C18H17F3N2O5 |
| Molecular Weight | 398.34 g/mol |
| Exact Mass | 398.11 |
| IUPAC Name | 6-(5,6-dihydroxy-4,7-dimethyl-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-2-yl)-6-(trifluoromethyl)cyclohexa-2,4-diene-1-carbonitrile |
| SMILES | CC12OC(C)(C(O)C1O)C1C(=O)N(C3(C(F)(F)F)C=CC=CC3C#N)C(=O)C12 |
| InChI | InChI=1S/C18H17F3N2O5/c1-15-9-10(16(2,28-15)12(25)11(15)24)14(27)23(13(9)26)17(18(19,20)21)6-4-3-5-8(17)7-22/h3-6,8-12,24-25H,1-2H3 |
| InChIKey | QCXVSVOSPUWYBG-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 110.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.34 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|