C30H32F3N5O8 — CID 70013233
benzyl 3-[[2-[4-[(4-methyl-2-pyridinyl)amino]butanoylamino]acetyl]amino]-3-(3-nitrophenyl)propanoate;2,2,2-trifluoroacetic acid (PubChem CID 70013233) has the molecular formula C30H32F3N5O8 and a molecular weight of 647.61 g/mol. Its IUPAC name is benzyl 3-[[2-[4-[(4-methyl-2-pyridinyl)amino]butanoylamino]acetyl]amino]-3-(3-nitrophenyl)propanoate;2,2,2-trifluoroacetic acid.
| Compound Name | benzyl 3-[[2-[4-[(4-methyl-2-pyridinyl)amino]butanoylamino]acetyl]amino]-3-(3-nitrophenyl)propanoate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 70013233 |
| Molecular Formula | C30H32F3N5O8 |
| Molecular Weight | 647.61 g/mol |
| Exact Mass | 647.22 |
| IUPAC Name | benzyl 3-[[2-[4-[(4-methyl-2-pyridinyl)amino]butanoylamino]acetyl]amino]-3-(3-nitrophenyl)propanoate;2,2,2-trifluoroacetic acid |
| SMILES | Cc1ccnc(NCCCC(=O)NCC(=O)NC(CC(=O)OCc2ccccc2)c2cccc([N+](=O)[O-])c2)c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C28H31N5O6.C2HF3O2/c1-20-12-14-30-25(15-20)29-13-6-11-26(34)31-18-27(35)32-24(22-9-5-10-23(16-22)33(37)38)17-28(36)39-19-21-7-3-2-4-8-21;3-2(4,5)1(6)7/h2-5,7-10,12,14-16,24H,6,11,13,17-19H2,1H3,(H,29,30)(H,31,34)(H,32,35);(H,6,7) |
| InChIKey | RMQCRGQSRBMSDL-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 189.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.61 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|