About 5,6-dichloro-5-ethenylcyclohexa-1,3-diene
5,6-dichloro-5-ethenylcyclohexa-1,3-diene (PubChem CID 70013789) has the molecular formula C8H8Cl2
and a molecular weight of 175.06 g/mol. Its IUPAC name is 5,6-dichloro-5-ethenylcyclohexa-1,3-diene.
Molecular Properties
| Compound Name | 5,6-dichloro-5-ethenylcyclohexa-1,3-diene |
| PubChem CID | 70013789 |
| Molecular Formula | C8H8Cl2 |
| Molecular Weight | 175.06 g/mol |
| Exact Mass | 174.00 |
| IUPAC Name | 5,6-dichloro-5-ethenylcyclohexa-1,3-diene |
| SMILES | C=CC1(Cl)C=CC=CC1Cl |
| InChI | InChI=1S/C8H8Cl2/c1-2-8(10)6-4-3-5-7(8)9/h2-7H,1H2 |
| InChIKey | UUVOWFWRTLPGBP-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.06 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5,6-dichloro-5-ethenylcyclohexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-dichloro-5-ethenylcyclohexa-1,3-diene?
The IUPAC name of 5,6-dichloro-5-ethenylcyclohexa-1,3-diene (CID 70013789) is 5,6-dichloro-5-ethenylcyclohexa-1,3-diene.
What is the SMILES notation for 5,6-dichloro-5-ethenylcyclohexa-1,3-diene?
The canonical SMILES for 5,6-dichloro-5-ethenylcyclohexa-1,3-diene is C=CC1(Cl)C=CC=CC1Cl.
What is the InChIKey of 5,6-dichloro-5-ethenylcyclohexa-1,3-diene?
The InChIKey is UUVOWFWRTLPGBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8Cl2/c1-2-8(10)6-4-3-5-7(8)9/h2-7H,1H2.
What are the key properties of 5,6-dichloro-5-ethenylcyclohexa-1,3-diene?
5,6-dichloro-5-ethenylcyclohexa-1,3-diene has a molecular weight of 175.06 g/mol, XLogP of 2.88, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dichloro-5-ethenylcyclohexa-1,3-diene is sourced from PubChem (CID 70013789), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).