About 2,6-bis(4,5-dimethyl-4H-imidazol-2-yl)pyridine;iron(3+);trichloride
2,6-bis(4,5-dimethyl-4H-imidazol-2-yl)pyridine;iron(3+);trichloride (PubChem CID 70014528) has the molecular formula C15H17Cl3FeN5
and a molecular weight of 429.54 g/mol. Its IUPAC name is 2,6-bis(4,5-dimethyl-4H-imidazol-2-yl)pyridine;iron(3+);trichloride.
Molecular Properties
| Compound Name | 2,6-bis(4,5-dimethyl-4H-imidazol-2-yl)pyridine;iron(3+);trichloride |
| PubChem CID | 70014528 |
| Molecular Formula | C15H17Cl3FeN5 |
| Molecular Weight | 429.54 g/mol |
| Exact Mass | 427.99 |
| IUPAC Name | 2,6-bis(4,5-dimethyl-4H-imidazol-2-yl)pyridine;iron(3+);trichloride |
| SMILES | CC1=NC(c2cccc(C3=NC(C)C(C)=N3)n2)=NC1C.[Cl-].[Cl-].[Cl-].[Fe+3] |
| InChI | InChI=1S/C15H17N5.3ClH.Fe/c1-8-9(2)17-14(16-8)12-6-5-7-13(20-12)15-18-10(3)11(4)19-15;;;;/h5-8,10H,1-4H3;3*1H;/q;;;;+3/p-3 |
| InChIKey | MHJGVJFIQLJNET-UHFFFAOYSA-K |
| XLogP | -6.69 |
| TPSA | 62.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 429.54 |
| LogP ≤ 5 | -6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2,6-bis(4,5-dimethyl-4H-imidazol-2-yl)pyridine;iron(3+);trichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-bis(4,5-dimethyl-4H-imidazol-2-yl)pyridine;iron(3+);trichloride?
The IUPAC name of 2,6-bis(4,5-dimethyl-4H-imidazol-2-yl)pyridine;iron(3+);trichloride (CID 70014528) is 2,6-bis(4,5-dimethyl-4H-imidazol-2-yl)pyridine;iron(3+);trichloride.
What is the SMILES notation for 2,6-bis(4,5-dimethyl-4H-imidazol-2-yl)pyridine;iron(3+);trichloride?
The canonical SMILES for 2,6-bis(4,5-dimethyl-4H-imidazol-2-yl)pyridine;iron(3+);trichloride is CC1=NC(c2cccc(C3=NC(C)C(C)=N3)n2)=NC1C.[Cl-].[Cl-].[Cl-].[Fe+3].
What is the InChIKey of 2,6-bis(4,5-dimethyl-4H-imidazol-2-yl)pyridine;iron(3+);trichloride?
The InChIKey is MHJGVJFIQLJNET-UHFFFAOYSA-K. The full InChI is InChI=1S/C15H17N5.3ClH.Fe/c1-8-9(2)17-14(16-8)12-6-5-7-13(20-12)15-18-10(3)11(4)19-15;;;;/h5-8,10H,1-4H3;3*1H;/q;;;;+3/p-3.
What are the key properties of 2,6-bis(4,5-dimethyl-4H-imidazol-2-yl)pyridine;iron(3+);trichloride?
2,6-bis(4,5-dimethyl-4H-imidazol-2-yl)pyridine;iron(3+);trichloride has a molecular weight of 429.54 g/mol, XLogP of -6.69, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-bis(4,5-dimethyl-4H-imidazol-2-yl)pyridine;iron(3+);trichloride is sourced from PubChem (CID 70014528), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).