C14H18O6Si2 — CID 70014607
trihydroxy-[4-(2-phenylethenyl)-1-trihydroxysilylcyclohexa-2,4-dien-1-yl]silane (PubChem CID 70014607) has the molecular formula C14H18O6Si2 and a molecular weight of 338.46 g/mol. Its IUPAC name is trihydroxy-[4-(2-phenylethenyl)-1-trihydroxysilylcyclohexa-2,4-dien-1-yl]silane.
| Compound Name | trihydroxy-[4-(2-phenylethenyl)-1-trihydroxysilylcyclohexa-2,4-dien-1-yl]silane |
|---|---|
| PubChem CID | 70014607 |
| Molecular Formula | C14H18O6Si2 |
| Molecular Weight | 338.46 g/mol |
| Exact Mass | 338.06 |
| IUPAC Name | trihydroxy-[4-(2-phenylethenyl)-1-trihydroxysilylcyclohexa-2,4-dien-1-yl]silane |
| SMILES | O[Si](O)(O)C1([Si](O)(O)O)C=CC(C=Cc2ccccc2)=CC1 |
| InChI | InChI=1S/C14H18O6Si2/c15-21(16,17)14(22(18,19)20)10-8-13(9-11-14)7-6-12-4-2-1-3-5-12/h1-10,15-20H,11H2 |
| InChIKey | DWQPMBRDUOZFCZ-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.46 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|