About N-ethyl-1-[6-(ethyliminomethyl)-4-methyl-2-pyridinyl]methanimine;iron(2+);dichloride
N-ethyl-1-[6-(ethyliminomethyl)-4-methyl-2-pyridinyl]methanimine;iron(2+);dichloride (PubChem CID 70014771) has the molecular formula C12H17Cl2FeN3
and a molecular weight of 330.04 g/mol. Its IUPAC name is N-ethyl-1-[6-(ethyliminomethyl)-4-methyl-2-pyridinyl]methanimine;iron(2+);dichloride.
Molecular Properties
| Compound Name | N-ethyl-1-[6-(ethyliminomethyl)-4-methyl-2-pyridinyl]methanimine;iron(2+);dichloride |
| PubChem CID | 70014771 |
| Molecular Formula | C12H17Cl2FeN3 |
| Molecular Weight | 330.04 g/mol |
| Exact Mass | 329.01 |
| IUPAC Name | N-ethyl-1-[6-(ethyliminomethyl)-4-methyl-2-pyridinyl]methanimine;iron(2+);dichloride |
| SMILES | CC/N=C/c1cc(C)cc(/C=N/CC)n1.[Cl-].[Cl-].[Fe+2] |
| InChI | InChI=1S/C12H17N3.2ClH.Fe/c1-4-13-8-11-6-10(3)7-12(15-11)9-14-5-2;;;/h6-9H,4-5H2,1-3H3;2*1H;/q;;;+2/p-2/b13-8+,14-9+;;; |
| InChIKey | IOVVTOLAKOLRSP-REQNFQRASA-L |
| XLogP | -3.73 |
| TPSA | 37.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.04 |
| LogP ≤ 5 | -3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-ethyl-1-[6-(ethyliminomethyl)-4-methyl-2-pyridinyl]methanimine;iron(2+);dichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-1-[6-(ethyliminomethyl)-4-methyl-2-pyridinyl]methanimine;iron(2+);dichloride?
The IUPAC name of N-ethyl-1-[6-(ethyliminomethyl)-4-methyl-2-pyridinyl]methanimine;iron(2+);dichloride (CID 70014771) is N-ethyl-1-[6-(ethyliminomethyl)-4-methyl-2-pyridinyl]methanimine;iron(2+);dichloride.
What is the SMILES notation for N-ethyl-1-[6-(ethyliminomethyl)-4-methyl-2-pyridinyl]methanimine;iron(2+);dichloride?
The canonical SMILES for N-ethyl-1-[6-(ethyliminomethyl)-4-methyl-2-pyridinyl]methanimine;iron(2+);dichloride is CC/N=C/c1cc(C)cc(/C=N/CC)n1.[Cl-].[Cl-].[Fe+2].
What is the InChIKey of N-ethyl-1-[6-(ethyliminomethyl)-4-methyl-2-pyridinyl]methanimine;iron(2+);dichloride?
The InChIKey is IOVVTOLAKOLRSP-REQNFQRASA-L. The full InChI is InChI=1S/C12H17N3.2ClH.Fe/c1-4-13-8-11-6-10(3)7-12(15-11)9-14-5-2;;;/h6-9H,4-5H2,1-3H3;2*1H;/q;;;+2/p-2/b13-8+,14-9+;;;.
What are the key properties of N-ethyl-1-[6-(ethyliminomethyl)-4-methyl-2-pyridinyl]methanimine;iron(2+);dichloride?
N-ethyl-1-[6-(ethyliminomethyl)-4-methyl-2-pyridinyl]methanimine;iron(2+);dichloride has a molecular weight of 330.04 g/mol, XLogP of -3.73, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-1-[6-(ethyliminomethyl)-4-methyl-2-pyridinyl]methanimine;iron(2+);dichloride is sourced from PubChem (CID 70014771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).