C16H25N3O3 — CID 70014824
tert-butyl N-[1-(2-cyano-2,5-dihydropyrrol-1-yl)-3,3-dimethyl-1-oxobutan-2-yl]carbamate (PubChem CID 70014824) has the molecular formula C16H25N3O3 and a molecular weight of 307.39 g/mol. Its IUPAC name is tert-butyl N-[1-(2-cyano-2,5-dihydropyrrol-1-yl)-3,3-dimethyl-1-oxobutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-(2-cyano-2,5-dihydropyrrol-1-yl)-3,3-dimethyl-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 70014824 |
| Molecular Formula | C16H25N3O3 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.19 |
| IUPAC Name | tert-butyl N-[1-(2-cyano-2,5-dihydropyrrol-1-yl)-3,3-dimethyl-1-oxobutan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(C(=O)N1CC=CC1C#N)C(C)(C)C |
| InChI | InChI=1S/C16H25N3O3/c1-15(2,3)12(18-14(21)22-16(4,5)6)13(20)19-9-7-8-11(19)10-17/h7-8,11-12H,9H2,1-6H3,(H,18,21) |
| InChIKey | ZBHMXONIPXBXJO-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 82.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|