C25H24ClN3O2S — CID 70014889
N-(2-chloro-5-methoxyphenyl)-7-[5-(morpholin-4-ylmethyl)thiophen-3-yl]quinolin-4-amine (PubChem CID 70014889) has the molecular formula C25H24ClN3O2S and a molecular weight of 466.01 g/mol. Its IUPAC name is N-(2-chloro-5-methoxyphenyl)-7-[5-(morpholin-4-ylmethyl)thiophen-3-yl]quinolin-4-amine.
| Compound Name | N-(2-chloro-5-methoxyphenyl)-7-[5-(morpholin-4-ylmethyl)thiophen-3-yl]quinolin-4-amine |
|---|---|
| PubChem CID | 70014889 |
| Molecular Formula | C25H24ClN3O2S |
| Molecular Weight | 466.01 g/mol |
| Exact Mass | 465.13 |
| IUPAC Name | N-(2-chloro-5-methoxyphenyl)-7-[5-(morpholin-4-ylmethyl)thiophen-3-yl]quinolin-4-amine |
| SMILES | COc1ccc(Cl)c(Nc2ccnc3cc(-c4csc(CN5CCOCC5)c4)ccc23)c1 |
| InChI | InChI=1S/C25H24ClN3O2S/c1-30-19-3-5-22(26)25(14-19)28-23-6-7-27-24-13-17(2-4-21(23)24)18-12-20(32-16-18)15-29-8-10-31-11-9-29/h2-7,12-14,16H,8-11,15H2,1H3,(H,27,28) |
| InChIKey | OTUQYCAXJUCKCC-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 46.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.01 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |