About 1-(2,5-dimethoxyphenyl)sulfonyl-5,6-dimethylbenzimidazole
1-(2,5-dimethoxyphenyl)sulfonyl-5,6-dimethylbenzimidazole (PubChem CID 700152) has the molecular formula C17H18N2O4S
and a molecular weight of 346.41 g/mol. Its IUPAC name is 1-(2,5-dimethoxyphenyl)sulfonyl-5,6-dimethylbenzimidazole.
Molecular Properties
| Compound Name | 1-(2,5-dimethoxyphenyl)sulfonyl-5,6-dimethylbenzimidazole |
| PubChem CID | 700152 |
| Molecular Formula | C17H18N2O4S |
| Molecular Weight | 346.41 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | 1-(2,5-dimethoxyphenyl)sulfonyl-5,6-dimethylbenzimidazole |
| SMILES | COc1ccc(OC)c(S(=O)(=O)n2cnc3cc(C)c(C)cc32)c1 |
| InChI | InChI=1S/C17H18N2O4S/c1-11-7-14-15(8-12(11)2)19(10-18-14)24(20,21)17-9-13(22-3)5-6-16(17)23-4/h5-10H,1-4H3 |
| InChIKey | NANVRRCGNBSVCD-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.41 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-(2,5-dimethoxyphenyl)sulfonyl-5,6-dimethylbenzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,5-dimethoxyphenyl)sulfonyl-5,6-dimethylbenzimidazole?
The IUPAC name of 1-(2,5-dimethoxyphenyl)sulfonyl-5,6-dimethylbenzimidazole (CID 700152) is 1-(2,5-dimethoxyphenyl)sulfonyl-5,6-dimethylbenzimidazole.
What is the SMILES notation for 1-(2,5-dimethoxyphenyl)sulfonyl-5,6-dimethylbenzimidazole?
The canonical SMILES for 1-(2,5-dimethoxyphenyl)sulfonyl-5,6-dimethylbenzimidazole is COc1ccc(OC)c(S(=O)(=O)n2cnc3cc(C)c(C)cc32)c1.
What is the InChIKey of 1-(2,5-dimethoxyphenyl)sulfonyl-5,6-dimethylbenzimidazole?
The InChIKey is NANVRRCGNBSVCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18N2O4S/c1-11-7-14-15(8-12(11)2)19(10-18-14)24(20,21)17-9-13(22-3)5-6-16(17)23-4/h5-10H,1-4H3.
What are the key properties of 1-(2,5-dimethoxyphenyl)sulfonyl-5,6-dimethylbenzimidazole?
1-(2,5-dimethoxyphenyl)sulfonyl-5,6-dimethylbenzimidazole has a molecular weight of 346.41 g/mol, XLogP of 2.91, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,5-dimethoxyphenyl)sulfonyl-5,6-dimethylbenzimidazole is sourced from PubChem (CID 700152), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).