C27H38O2P+ — CID 70015352
[2-(4-tert-butyl-2,6-dimethylbenzoyl)phenyl]-oxo-(2,4,4-trimethylpentyl)phosphanium (PubChem CID 70015352) has the molecular formula C27H38O2P+ and a molecular weight of 425.57 g/mol. Its IUPAC name is [2-(4-tert-butyl-2,6-dimethylbenzoyl)phenyl]-oxo-(2,4,4-trimethylpentyl)phosphanium.
| Compound Name | [2-(4-tert-butyl-2,6-dimethylbenzoyl)phenyl]-oxo-(2,4,4-trimethylpentyl)phosphanium |
|---|---|
| PubChem CID | 70015352 |
| Molecular Formula | C27H38O2P+ |
| Molecular Weight | 425.57 g/mol |
| Exact Mass | 425.26 |
| IUPAC Name | [2-(4-tert-butyl-2,6-dimethylbenzoyl)phenyl]-oxo-(2,4,4-trimethylpentyl)phosphanium |
| SMILES | Cc1cc(C(C)(C)C)cc(C)c1C(=O)c1ccccc1[P+](=O)CC(C)CC(C)(C)C |
| InChI | InChI=1S/C27H38O2P/c1-18(16-26(4,5)6)17-30(29)23-13-11-10-12-22(23)25(28)24-19(2)14-21(15-20(24)3)27(7,8)9/h10-15,18H,16-17H2,1-9H3/q+1 |
| InChIKey | GPQZGGGJVAEPPH-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.57 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|