C25H31N5O — CID 70015500
1-[4-(diethylamino)butyl]-1-[4-(1,4-dihydroindeno[2,1-d]pyrazol-3-yl)phenyl]urea (PubChem CID 70015500) has the molecular formula C25H31N5O and a molecular weight of 417.56 g/mol. Its IUPAC name is 1-[4-(diethylamino)butyl]-1-[4-(1,4-dihydroindeno[2,1-d]pyrazol-3-yl)phenyl]urea.
| Compound Name | 1-[4-(diethylamino)butyl]-1-[4-(1,4-dihydroindeno[2,1-d]pyrazol-3-yl)phenyl]urea |
|---|---|
| PubChem CID | 70015500 |
| Molecular Formula | C25H31N5O |
| Molecular Weight | 417.56 g/mol |
| Exact Mass | 417.25 |
| IUPAC Name | 1-[4-(diethylamino)butyl]-1-[4-(1,4-dihydroindeno[2,1-d]pyrazol-3-yl)phenyl]urea |
| SMILES | CCN(CC)CCCCN(C(N)=O)c1ccc(-c2n[nH]c3c2Cc2ccccc2-3)cc1 |
| InChI | InChI=1S/C25H31N5O/c1-3-29(4-2)15-7-8-16-30(25(26)31)20-13-11-18(12-14-20)23-22-17-19-9-5-6-10-21(19)24(22)28-27-23/h5-6,9-14H,3-4,7-8,15-17H2,1-2H3,(H2,26,31)(H,27,28) |
| InChIKey | YHCHHEWPDJPLLP-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 78.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.56 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|