C18H28O — CID 7001562
(4aR,6aR,10bR)-spiro[1,2,3,4,4a,6a,7,8,9,10b-decahydrobenzo[c]chromene-6,1'-cyclohexane] (PubChem CID 7001562) has the molecular formula C18H28O and a molecular weight of 260.42 g/mol. Its IUPAC name is (4aR,6aR,10bR)-spiro[1,2,3,4,4a,6a,7,8,9,10b-decahydrobenzo[c]chromene-6,1'-cyclohexane].
| Compound Name | (4aR,6aR,10bR)-spiro[1,2,3,4,4a,6a,7,8,9,10b-decahydrobenzo[c]chromene-6,1'-cyclohexane] |
|---|---|
| PubChem CID | 7001562 |
| Molecular Formula | C18H28O |
| Molecular Weight | 260.42 g/mol |
| Exact Mass | 260.21 |
| IUPAC Name | (4aR,6aR,10bR)-spiro[1,2,3,4,4a,6a,7,8,9,10b-decahydrobenzo[c]chromene-6,1'-cyclohexane] |
| SMILES | C1=C2[C@H]3CCCC[C@H]3OC3(CCCCC3)[C@@H]2CCC1 |
| InChI | InChI=1S/C18H28O/c1-6-12-18(13-7-1)16-10-4-2-8-14(16)15-9-3-5-11-17(15)19-18/h8,15-17H,1-7,9-13H2/t15-,16-,17-/m1/s1 |
| InChIKey | IMFLUMXQDKOHDN-BRWVUGGUSA-N |
| XLogP | 5.00 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.42 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|