About (3-chloro-2,6-dimethoxyphenyl)-[(2,6-dichlorobenzoyl)-phenylphosphoryl]methanone
(3-chloro-2,6-dimethoxyphenyl)-[(2,6-dichlorobenzoyl)-phenylphosphoryl]methanone (PubChem CID 70016069) has the molecular formula C22H16Cl3O5P
and a molecular weight of 497.70 g/mol. Its IUPAC name is (3-chloro-2,6-dimethoxyphenyl)-[(2,6-dichlorobenzoyl)-phenylphosphoryl]methanone.
Molecular Properties
| Compound Name | (3-chloro-2,6-dimethoxyphenyl)-[(2,6-dichlorobenzoyl)-phenylphosphoryl]methanone |
| PubChem CID | 70016069 |
| Molecular Formula | C22H16Cl3O5P |
| Molecular Weight | 497.70 g/mol |
| Exact Mass | 495.98 |
| IUPAC Name | (3-chloro-2,6-dimethoxyphenyl)-[(2,6-dichlorobenzoyl)-phenylphosphoryl]methanone |
| SMILES | COc1ccc(Cl)c(OC)c1C(=O)P(=O)(C(=O)c1c(Cl)cccc1Cl)c1ccccc1 |
| InChI | InChI=1S/C22H16Cl3O5P/c1-29-17-12-11-16(25)20(30-2)19(17)22(27)31(28,13-7-4-3-5-8-13)21(26)18-14(23)9-6-10-15(18)24/h3-12H,1-2H3 |
| InChIKey | ZMOMGOAHSDFVIR-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 497.70 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (3-chloro-2,6-dimethoxyphenyl)-[(2,6-dichlorobenzoyl)-phenylphosphoryl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-chloro-2,6-dimethoxyphenyl)-[(2,6-dichlorobenzoyl)-phenylphosphoryl]methanone?
The IUPAC name of (3-chloro-2,6-dimethoxyphenyl)-[(2,6-dichlorobenzoyl)-phenylphosphoryl]methanone (CID 70016069) is (3-chloro-2,6-dimethoxyphenyl)-[(2,6-dichlorobenzoyl)-phenylphosphoryl]methanone.
What is the SMILES notation for (3-chloro-2,6-dimethoxyphenyl)-[(2,6-dichlorobenzoyl)-phenylphosphoryl]methanone?
The canonical SMILES for (3-chloro-2,6-dimethoxyphenyl)-[(2,6-dichlorobenzoyl)-phenylphosphoryl]methanone is COc1ccc(Cl)c(OC)c1C(=O)P(=O)(C(=O)c1c(Cl)cccc1Cl)c1ccccc1.
What is the InChIKey of (3-chloro-2,6-dimethoxyphenyl)-[(2,6-dichlorobenzoyl)-phenylphosphoryl]methanone?
The InChIKey is ZMOMGOAHSDFVIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H16Cl3O5P/c1-29-17-12-11-16(25)20(30-2)19(17)22(27)31(28,13-7-4-3-5-8-13)21(26)18-14(23)9-6-10-15(18)24/h3-12H,1-2H3.
What are the key properties of (3-chloro-2,6-dimethoxyphenyl)-[(2,6-dichlorobenzoyl)-phenylphosphoryl]methanone?
(3-chloro-2,6-dimethoxyphenyl)-[(2,6-dichlorobenzoyl)-phenylphosphoryl]methanone has a molecular weight of 497.70 g/mol, XLogP of 6.33, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3-chloro-2,6-dimethoxyphenyl)-[(2,6-dichlorobenzoyl)-phenylphosphoryl]methanone is sourced from PubChem (CID 70016069), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).