About 6-tert-butyl-2-methyl-4-piperidin-4-ylthieno[3,2-d]pyrimidine;hydrochloride
6-tert-butyl-2-methyl-4-piperidin-4-ylthieno[3,2-d]pyrimidine;hydrochloride (PubChem CID 70016451) has the molecular formula C16H24ClN3S
and a molecular weight of 325.91 g/mol. Its IUPAC name is 6-tert-butyl-2-methyl-4-piperidin-4-ylthieno[3,2-d]pyrimidine;hydrochloride.
Molecular Properties
| Compound Name | 6-tert-butyl-2-methyl-4-piperidin-4-ylthieno[3,2-d]pyrimidine;hydrochloride |
| PubChem CID | 70016451 |
| Molecular Formula | C16H24ClN3S |
| Molecular Weight | 325.91 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | 6-tert-butyl-2-methyl-4-piperidin-4-ylthieno[3,2-d]pyrimidine;hydrochloride |
| SMILES | Cc1nc(C2CCNCC2)c2sc(C(C)(C)C)cc2n1.Cl |
| InChI | InChI=1S/C16H23N3S.ClH/c1-10-18-12-9-13(16(2,3)4)20-15(12)14(19-10)11-5-7-17-8-6-11;/h9,11,17H,5-8H2,1-4H3;1H |
| InChIKey | RJCDUIARGRZRFI-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.91 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-tert-butyl-2-methyl-4-piperidin-4-ylthieno[3,2-d]pyrimidine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-tert-butyl-2-methyl-4-piperidin-4-ylthieno[3,2-d]pyrimidine;hydrochloride?
The IUPAC name of 6-tert-butyl-2-methyl-4-piperidin-4-ylthieno[3,2-d]pyrimidine;hydrochloride (CID 70016451) is 6-tert-butyl-2-methyl-4-piperidin-4-ylthieno[3,2-d]pyrimidine;hydrochloride.
What is the SMILES notation for 6-tert-butyl-2-methyl-4-piperidin-4-ylthieno[3,2-d]pyrimidine;hydrochloride?
The canonical SMILES for 6-tert-butyl-2-methyl-4-piperidin-4-ylthieno[3,2-d]pyrimidine;hydrochloride is Cc1nc(C2CCNCC2)c2sc(C(C)(C)C)cc2n1.Cl.
What is the InChIKey of 6-tert-butyl-2-methyl-4-piperidin-4-ylthieno[3,2-d]pyrimidine;hydrochloride?
The InChIKey is RJCDUIARGRZRFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23N3S.ClH/c1-10-18-12-9-13(16(2,3)4)20-15(12)14(19-10)11-5-7-17-8-6-11;/h9,11,17H,5-8H2,1-4H3;1H.
What are the key properties of 6-tert-butyl-2-methyl-4-piperidin-4-ylthieno[3,2-d]pyrimidine;hydrochloride?
6-tert-butyl-2-methyl-4-piperidin-4-ylthieno[3,2-d]pyrimidine;hydrochloride has a molecular weight of 325.91 g/mol, XLogP of 4.19, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-tert-butyl-2-methyl-4-piperidin-4-ylthieno[3,2-d]pyrimidine;hydrochloride is sourced from PubChem (CID 70016451), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).