C18H28OSi — CID 70017602
(2-tert-butyl-1-methoxycyclohexa-2,4-dien-1-yl)-cyclopenta-1,3-dien-1-yl-dimethylsilane (PubChem CID 70017602) has the molecular formula C18H28OSi and a molecular weight of 288.51 g/mol. Its IUPAC name is (2-tert-butyl-1-methoxycyclohexa-2,4-dien-1-yl)-cyclopenta-1,3-dien-1-yl-dimethylsilane.
| Compound Name | (2-tert-butyl-1-methoxycyclohexa-2,4-dien-1-yl)-cyclopenta-1,3-dien-1-yl-dimethylsilane |
|---|---|
| PubChem CID | 70017602 |
| Molecular Formula | C18H28OSi |
| Molecular Weight | 288.51 g/mol |
| Exact Mass | 288.19 |
| IUPAC Name | (2-tert-butyl-1-methoxycyclohexa-2,4-dien-1-yl)-cyclopenta-1,3-dien-1-yl-dimethylsilane |
| SMILES | COC1([Si](C)(C)C2=CC=CC2)CC=CC=C1C(C)(C)C |
| InChI | InChI=1S/C18H28OSi/c1-17(2,3)16-13-9-10-14-18(16,19-4)20(5,6)15-11-7-8-12-15/h7-11,13H,12,14H2,1-6H3 |
| InChIKey | VGSAAKXJFAMXAF-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.51 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|