C15H25NO3 — CID 7001791
(1S,6R)-3,4-dimethyl-6-(pentylcarbamoyl)cyclohex-3-ene-1-carboxylic acid (PubChem CID 7001791) has the molecular formula C15H25NO3 and a molecular weight of 267.37 g/mol. Its IUPAC name is (1S,6R)-3,4-dimethyl-6-(pentylcarbamoyl)cyclohex-3-ene-1-carboxylic acid.
| Compound Name | (1S,6R)-3,4-dimethyl-6-(pentylcarbamoyl)cyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 7001791 |
| Molecular Formula | C15H25NO3 |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.18 |
| IUPAC Name | (1S,6R)-3,4-dimethyl-6-(pentylcarbamoyl)cyclohex-3-ene-1-carboxylic acid |
| SMILES | CCCCCNC(=O)[C@@H]1CC(C)=C(C)C[C@@H]1C(=O)O |
| InChI | InChI=1S/C15H25NO3/c1-4-5-6-7-16-14(17)12-8-10(2)11(3)9-13(12)15(18)19/h12-13H,4-9H2,1-3H3,(H,16,17)(H,18,19)/t12-,13+/m1/s1 |
| InChIKey | NJAPKPKANSMAPV-OLZOCXBDSA-N |
| XLogP | 2.74 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|