About 6-hydroxy-3,4-dioxocyclohexa-1,5-diene-1-carboxylic acid
6-hydroxy-3,4-dioxocyclohexa-1,5-diene-1-carboxylic acid (PubChem CID 70018136) has the molecular formula C7H4O5
and a molecular weight of 168.10 g/mol. Its IUPAC name is 6-hydroxy-3,4-dioxocyclohexa-1,5-diene-1-carboxylic acid.
Molecular Properties
| Compound Name | 6-hydroxy-3,4-dioxocyclohexa-1,5-diene-1-carboxylic acid |
| PubChem CID | 70018136 |
| Molecular Formula | C7H4O5 |
| Molecular Weight | 168.10 g/mol |
| Exact Mass | 168.01 |
| IUPAC Name | 6-hydroxy-3,4-dioxocyclohexa-1,5-diene-1-carboxylic acid |
| SMILES | O=C(O)C1=CC(=O)C(=O)C=C1O |
| InChI | InChI=1S/C7H4O5/c8-4-2-6(10)5(9)1-3(4)7(11)12/h1-2,8H,(H,11,12) |
| InChIKey | SGMMSHGREFDBLB-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.10 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 6-hydroxy-3,4-dioxocyclohexa-1,5-diene-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-hydroxy-3,4-dioxocyclohexa-1,5-diene-1-carboxylic acid?
The IUPAC name of 6-hydroxy-3,4-dioxocyclohexa-1,5-diene-1-carboxylic acid (CID 70018136) is 6-hydroxy-3,4-dioxocyclohexa-1,5-diene-1-carboxylic acid.
What is the SMILES notation for 6-hydroxy-3,4-dioxocyclohexa-1,5-diene-1-carboxylic acid?
The canonical SMILES for 6-hydroxy-3,4-dioxocyclohexa-1,5-diene-1-carboxylic acid is O=C(O)C1=CC(=O)C(=O)C=C1O.
What is the InChIKey of 6-hydroxy-3,4-dioxocyclohexa-1,5-diene-1-carboxylic acid?
The InChIKey is SGMMSHGREFDBLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4O5/c8-4-2-6(10)5(9)1-3(4)7(11)12/h1-2,8H,(H,11,12).
What are the key properties of 6-hydroxy-3,4-dioxocyclohexa-1,5-diene-1-carboxylic acid?
6-hydroxy-3,4-dioxocyclohexa-1,5-diene-1-carboxylic acid has a molecular weight of 168.10 g/mol, XLogP of -0.41, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-hydroxy-3,4-dioxocyclohexa-1,5-diene-1-carboxylic acid is sourced from PubChem (CID 70018136), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).