About 2,7-dimethyl-5,8-dioxaspiro[2.7]decane-4,9-dione
2,7-dimethyl-5,8-dioxaspiro[2.7]decane-4,9-dione (PubChem CID 70018181) has the molecular formula C10H14O4
and a molecular weight of 198.22 g/mol. Its IUPAC name is 2,7-dimethyl-5,8-dioxaspiro[2.7]decane-4,9-dione.
Molecular Properties
| Compound Name | 2,7-dimethyl-5,8-dioxaspiro[2.7]decane-4,9-dione |
| PubChem CID | 70018181 |
| Molecular Formula | C10H14O4 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | 2,7-dimethyl-5,8-dioxaspiro[2.7]decane-4,9-dione |
| SMILES | CC1COC(=O)C2(CC(=O)O1)CC2C |
| InChI | InChI=1S/C10H14O4/c1-6-3-10(6)4-8(11)14-7(2)5-13-9(10)12/h6-7H,3-5H2,1-2H3 |
| InChIKey | PVQMIUNBAVCWLY-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,7-dimethyl-5,8-dioxaspiro[2.7]decane-4,9-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,7-dimethyl-5,8-dioxaspiro[2.7]decane-4,9-dione?
The IUPAC name of 2,7-dimethyl-5,8-dioxaspiro[2.7]decane-4,9-dione (CID 70018181) is 2,7-dimethyl-5,8-dioxaspiro[2.7]decane-4,9-dione.
What is the SMILES notation for 2,7-dimethyl-5,8-dioxaspiro[2.7]decane-4,9-dione?
The canonical SMILES for 2,7-dimethyl-5,8-dioxaspiro[2.7]decane-4,9-dione is CC1COC(=O)C2(CC(=O)O1)CC2C.
What is the InChIKey of 2,7-dimethyl-5,8-dioxaspiro[2.7]decane-4,9-dione?
The InChIKey is PVQMIUNBAVCWLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O4/c1-6-3-10(6)4-8(11)14-7(2)5-13-9(10)12/h6-7H,3-5H2,1-2H3.
What are the key properties of 2,7-dimethyl-5,8-dioxaspiro[2.7]decane-4,9-dione?
2,7-dimethyl-5,8-dioxaspiro[2.7]decane-4,9-dione has a molecular weight of 198.22 g/mol, XLogP of 0.89, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,7-dimethyl-5,8-dioxaspiro[2.7]decane-4,9-dione is sourced from PubChem (CID 70018181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).