C34H45F3O5S — CID 70018664
(8S,9R,11S,13S,14S,17S)-13-methyl-11-[4-[6-(4,4,4-trifluorobutylsulfonyl)hexoxy]phenyl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol (PubChem CID 70018664) has the molecular formula C34H45F3O5S and a molecular weight of 622.79 g/mol. Its IUPAC name is (8S,9R,11S,13S,14S,17S)-13-methyl-11-[4-[6-(4,4,4-trifluorobutylsulfonyl)hexoxy]phenyl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol.
| Compound Name | (8S,9R,11S,13S,14S,17S)-13-methyl-11-[4-[6-(4,4,4-trifluorobutylsulfonyl)hexoxy]phenyl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol |
|---|---|
| PubChem CID | 70018664 |
| Molecular Formula | C34H45F3O5S |
| Molecular Weight | 622.79 g/mol |
| Exact Mass | 622.29 |
| IUPAC Name | (8S,9R,11S,13S,14S,17S)-13-methyl-11-[4-[6-(4,4,4-trifluorobutylsulfonyl)hexoxy]phenyl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol |
| SMILES | C[C@]12C[C@H](c3ccc(OCCCCCCS(=O)(=O)CCCC(F)(F)F)cc3)[C@@H]3c4ccc(O)cc4CC[C@H]3[C@@H]1CC[C@@H]2O |
| InChI | InChI=1S/C34H45F3O5S/c1-33-22-29(32-27-14-10-25(38)21-24(27)9-13-28(32)30(33)15-16-31(33)39)23-7-11-26(12-8-23)42-18-4-2-3-5-19-43(40,41)20-6-17-34(35,36)37/h7-8,10-12,14,21,28-32,38-39H,2-6,9,13,15-20,22H2,1H3/t28-,29+,30-,31-,32+,33-/m0/s1 |
| InChIKey | DUMBXJKTXOMZSF-VVRUPBQJSA-N |
| XLogP | 7.70 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.79 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|