C18H26S — CID 70018733
6-butylsulfanyl-6-(cyclopenta-1,3-dien-1-ylmethyl)-1,3-dimethylcyclohexa-1,3-diene (PubChem CID 70018733) has the molecular formula C18H26S and a molecular weight of 274.47 g/mol. Its IUPAC name is 6-butylsulfanyl-6-(cyclopenta-1,3-dien-1-ylmethyl)-1,3-dimethylcyclohexa-1,3-diene.
| Compound Name | 6-butylsulfanyl-6-(cyclopenta-1,3-dien-1-ylmethyl)-1,3-dimethylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 70018733 |
| Molecular Formula | C18H26S |
| Molecular Weight | 274.47 g/mol |
| Exact Mass | 274.18 |
| IUPAC Name | 6-butylsulfanyl-6-(cyclopenta-1,3-dien-1-ylmethyl)-1,3-dimethylcyclohexa-1,3-diene |
| SMILES | CCCCSC1(CC2=CC=CC2)CC=C(C)C=C1C |
| InChI | InChI=1S/C18H26S/c1-4-5-12-19-18(14-17-8-6-7-9-17)11-10-15(2)13-16(18)3/h6-8,10,13H,4-5,9,11-12,14H2,1-3H3 |
| InChIKey | MZMVVFWUYVQBAL-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.47 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|