C35H43NO3S — CID 70018816
(8S,9R,11S,13S,14S,17S)-13-methyl-11-[4-[5-(pyridin-3-ylmethylsulfanyl)pentoxy]phenyl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol (PubChem CID 70018816) has the molecular formula C35H43NO3S and a molecular weight of 557.80 g/mol. Its IUPAC name is (8S,9R,11S,13S,14S,17S)-13-methyl-11-[4-[5-(pyridin-3-ylmethylsulfanyl)pentoxy]phenyl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol.
| Compound Name | (8S,9R,11S,13S,14S,17S)-13-methyl-11-[4-[5-(pyridin-3-ylmethylsulfanyl)pentoxy]phenyl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol |
|---|---|
| PubChem CID | 70018816 |
| Molecular Formula | C35H43NO3S |
| Molecular Weight | 557.80 g/mol |
| Exact Mass | 557.30 |
| IUPAC Name | (8S,9R,11S,13S,14S,17S)-13-methyl-11-[4-[5-(pyridin-3-ylmethylsulfanyl)pentoxy]phenyl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol |
| SMILES | C[C@]12C[C@H](c3ccc(OCCCCCSCc4cccnc4)cc3)[C@@H]3c4ccc(O)cc4CC[C@H]3[C@@H]1CC[C@@H]2O |
| InChI | InChI=1S/C35H43NO3S/c1-35-21-31(34-29-14-10-27(37)20-26(29)9-13-30(34)32(35)15-16-33(35)38)25-7-11-28(12-8-25)39-18-3-2-4-19-40-23-24-6-5-17-36-22-24/h5-8,10-12,14,17,20,22,30-34,37-38H,2-4,9,13,15-16,18-19,21,23H2,1H3/t30-,31+,32-,33-,34+,35-/m0/s1 |
| InChIKey | VPZXIHJBNKOGLJ-VHRWCXMQSA-N |
| XLogP | 7.88 |
| TPSA | 62.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.80 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|