C16H18O4 — CID 70018832
3,3-di(cyclopenta-1,3-dien-1-yloxy)-2-methylidenepentanoic acid (PubChem CID 70018832) has the molecular formula C16H18O4 and a molecular weight of 274.32 g/mol. Its IUPAC name is 3,3-di(cyclopenta-1,3-dien-1-yloxy)-2-methylidenepentanoic acid.
| Compound Name | 3,3-di(cyclopenta-1,3-dien-1-yloxy)-2-methylidenepentanoic acid |
|---|---|
| PubChem CID | 70018832 |
| Molecular Formula | C16H18O4 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | 3,3-di(cyclopenta-1,3-dien-1-yloxy)-2-methylidenepentanoic acid |
| SMILES | C=C(C(=O)O)C(CC)(OC1=CC=CC1)OC1=CC=CC1 |
| InChI | InChI=1S/C16H18O4/c1-3-16(12(2)15(17)18,19-13-8-4-5-9-13)20-14-10-6-7-11-14/h4-8,10H,2-3,9,11H2,1H3,(H,17,18) |
| InChIKey | VJFMBLHIIKGIMI-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|