C19H19FN2O7S — CID 70019566
1-carbamoyl-4-[4-(2-fluorophenoxy)phenyl]sulfonyl-3-hydroxypiperidine-3-carboxylic acid (PubChem CID 70019566) has the molecular formula C19H19FN2O7S and a molecular weight of 438.43 g/mol. Its IUPAC name is 1-carbamoyl-4-[4-(2-fluorophenoxy)phenyl]sulfonyl-3-hydroxypiperidine-3-carboxylic acid.
| Compound Name | 1-carbamoyl-4-[4-(2-fluorophenoxy)phenyl]sulfonyl-3-hydroxypiperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 70019566 |
| Molecular Formula | C19H19FN2O7S |
| Molecular Weight | 438.43 g/mol |
| Exact Mass | 438.09 |
| IUPAC Name | 1-carbamoyl-4-[4-(2-fluorophenoxy)phenyl]sulfonyl-3-hydroxypiperidine-3-carboxylic acid |
| SMILES | NC(=O)N1CCC(S(=O)(=O)c2ccc(Oc3ccccc3F)cc2)C(O)(C(=O)O)C1 |
| InChI | InChI=1S/C19H19FN2O7S/c20-14-3-1-2-4-15(14)29-12-5-7-13(8-6-12)30(27,28)16-9-10-22(18(21)25)11-19(16,26)17(23)24/h1-8,16,26H,9-11H2,(H2,21,25)(H,23,24) |
| InChIKey | ZMUQUVUKUFVBNA-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 147.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.43 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |