C28H28ClF3N2 — CID 70019672
(8aS)-4-benzhydryl-2-[[2-chloro-5-(trifluoromethyl)phenyl]methyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine (PubChem CID 70019672) has the molecular formula C28H28ClF3N2 and a molecular weight of 484.99 g/mol. Its IUPAC name is (8aS)-4-benzhydryl-2-[[2-chloro-5-(trifluoromethyl)phenyl]methyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine.
| Compound Name | (8aS)-4-benzhydryl-2-[[2-chloro-5-(trifluoromethyl)phenyl]methyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine |
|---|---|
| PubChem CID | 70019672 |
| Molecular Formula | C28H28ClF3N2 |
| Molecular Weight | 484.99 g/mol |
| Exact Mass | 484.19 |
| IUPAC Name | (8aS)-4-benzhydryl-2-[[2-chloro-5-(trifluoromethyl)phenyl]methyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine |
| SMILES | FC(F)(F)c1ccc(Cl)c(CN2CC(C(c3ccccc3)c3ccccc3)N3CCC[C@H]3C2)c1 |
| InChI | InChI=1S/C28H28ClF3N2/c29-25-14-13-23(28(30,31)32)16-22(25)17-33-18-24-12-7-15-34(24)26(19-33)27(20-8-3-1-4-9-20)21-10-5-2-6-11-21/h1-6,8-11,13-14,16,24,26-27H,7,12,15,17-19H2/t24-,26?/m0/s1 |
| InChIKey | JZDYFUUAGQTDAH-QSAPEBAKSA-N |
| XLogP | 6.84 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.99 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |