About 2-[5-(aminomethyl)-3-oxo-1,2-oxazol-4-yl]propanoic acid;hydrobromide
2-[5-(aminomethyl)-3-oxo-1,2-oxazol-4-yl]propanoic acid;hydrobromide (PubChem CID 70019732) has the molecular formula C7H11BrN2O4
and a molecular weight of 267.08 g/mol. Its IUPAC name is 2-[5-(aminomethyl)-3-oxo-1,2-oxazol-4-yl]propanoic acid;hydrobromide.
Molecular Properties
| Compound Name | 2-[5-(aminomethyl)-3-oxo-1,2-oxazol-4-yl]propanoic acid;hydrobromide |
| PubChem CID | 70019732 |
| Molecular Formula | C7H11BrN2O4 |
| Molecular Weight | 267.08 g/mol |
| Exact Mass | 265.99 |
| IUPAC Name | 2-[5-(aminomethyl)-3-oxo-1,2-oxazol-4-yl]propanoic acid;hydrobromide |
| SMILES | Br.CC(C(=O)O)c1c(CN)o[nH]c1=O |
| InChI | InChI=1S/C7H10N2O4.BrH/c1-3(7(11)12)5-4(2-8)13-9-6(5)10;/h3H,2,8H2,1H3,(H,9,10)(H,11,12);1H |
| InChIKey | SFEHTGAEKSOTQR-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 109.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.08 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[5-(aminomethyl)-3-oxo-1,2-oxazol-4-yl]propanoic acid;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-(aminomethyl)-3-oxo-1,2-oxazol-4-yl]propanoic acid;hydrobromide?
The IUPAC name of 2-[5-(aminomethyl)-3-oxo-1,2-oxazol-4-yl]propanoic acid;hydrobromide (CID 70019732) is 2-[5-(aminomethyl)-3-oxo-1,2-oxazol-4-yl]propanoic acid;hydrobromide.
What is the SMILES notation for 2-[5-(aminomethyl)-3-oxo-1,2-oxazol-4-yl]propanoic acid;hydrobromide?
The canonical SMILES for 2-[5-(aminomethyl)-3-oxo-1,2-oxazol-4-yl]propanoic acid;hydrobromide is Br.CC(C(=O)O)c1c(CN)o[nH]c1=O.
What is the InChIKey of 2-[5-(aminomethyl)-3-oxo-1,2-oxazol-4-yl]propanoic acid;hydrobromide?
The InChIKey is SFEHTGAEKSOTQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O4.BrH/c1-3(7(11)12)5-4(2-8)13-9-6(5)10;/h3H,2,8H2,1H3,(H,9,10)(H,11,12);1H.
What are the key properties of 2-[5-(aminomethyl)-3-oxo-1,2-oxazol-4-yl]propanoic acid;hydrobromide?
2-[5-(aminomethyl)-3-oxo-1,2-oxazol-4-yl]propanoic acid;hydrobromide has a molecular weight of 267.08 g/mol, XLogP of 0.19, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-(aminomethyl)-3-oxo-1,2-oxazol-4-yl]propanoic acid;hydrobromide is sourced from PubChem (CID 70019732), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).