C30H31Cl2N7OS — CID 70019862
3,6-bis(2-chlorophenyl)-1,2,4,5-tetrazine;2-tert-butylimino-5-phenyl-3-propan-2-yl-1,3,5-thiadiazinan-4-one (PubChem CID 70019862) has the molecular formula C30H31Cl2N7OS and a molecular weight of 608.60 g/mol. Its IUPAC name is 3,6-bis(2-chlorophenyl)-1,2,4,5-tetrazine;2-tert-butylimino-5-phenyl-3-propan-2-yl-1,3,5-thiadiazinan-4-one.
| Compound Name | 3,6-bis(2-chlorophenyl)-1,2,4,5-tetrazine;2-tert-butylimino-5-phenyl-3-propan-2-yl-1,3,5-thiadiazinan-4-one |
|---|---|
| PubChem CID | 70019862 |
| Molecular Formula | C30H31Cl2N7OS |
| Molecular Weight | 608.60 g/mol |
| Exact Mass | 607.17 |
| IUPAC Name | 3,6-bis(2-chlorophenyl)-1,2,4,5-tetrazine;2-tert-butylimino-5-phenyl-3-propan-2-yl-1,3,5-thiadiazinan-4-one |
| SMILES | CC(C)N1C(=O)N(c2ccccc2)CS/C1=N\C(C)(C)C.Clc1ccccc1-c1nnc(-c2ccccc2Cl)nn1 |
| InChI | InChI=1S/C16H23N3OS.C14H8Cl2N4/c1-12(2)19-14(17-16(3,4)5)21-11-18(15(19)20)13-9-7-6-8-10-13;15-11-7-3-1-5-9(11)13-17-19-14(20-18-13)10-6-2-4-8-12(10)16/h6-10,12H,11H2,1-5H3;1-8H/b17-14-; |
| InChIKey | SBTGEBHRGRUFOC-SBBUSYCLSA-N |
| XLogP | 8.09 |
| TPSA | 87.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.60 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|