C32H41F3O5S — CID 70020138
(8S,9R,11S,13S,14S,17S)-13-methyl-11-[4-[4-(4,4,4-trifluorobutylsulfonyl)butoxy]phenyl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol (PubChem CID 70020138) has the molecular formula C32H41F3O5S and a molecular weight of 594.74 g/mol. Its IUPAC name is (8S,9R,11S,13S,14S,17S)-13-methyl-11-[4-[4-(4,4,4-trifluorobutylsulfonyl)butoxy]phenyl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol.
| Compound Name | (8S,9R,11S,13S,14S,17S)-13-methyl-11-[4-[4-(4,4,4-trifluorobutylsulfonyl)butoxy]phenyl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol |
|---|---|
| PubChem CID | 70020138 |
| Molecular Formula | C32H41F3O5S |
| Molecular Weight | 594.74 g/mol |
| Exact Mass | 594.26 |
| IUPAC Name | (8S,9R,11S,13S,14S,17S)-13-methyl-11-[4-[4-(4,4,4-trifluorobutylsulfonyl)butoxy]phenyl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol |
| SMILES | C[C@]12C[C@H](c3ccc(OCCCCS(=O)(=O)CCCC(F)(F)F)cc3)[C@@H]3c4ccc(O)cc4CC[C@H]3[C@@H]1CC[C@@H]2O |
| InChI | InChI=1S/C32H41F3O5S/c1-31-20-27(30-25-12-8-23(36)19-22(25)7-11-26(30)28(31)13-14-29(31)37)21-5-9-24(10-6-21)40-16-2-3-17-41(38,39)18-4-15-32(33,34)35/h5-6,8-10,12,19,26-30,36-37H,2-4,7,11,13-18,20H2,1H3/t26-,27+,28-,29-,30+,31-/m0/s1 |
| InChIKey | KTCSXSZEGVXABJ-YYPWWLTISA-N |
| XLogP | 6.92 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.74 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|