About 4-aminobenzenesulfonamide;5-(4-chlorophenyl)-6-ethylpyrimidine-2,4-diamine
4-aminobenzenesulfonamide;5-(4-chlorophenyl)-6-ethylpyrimidine-2,4-diamine (PubChem CID 70020180) has the molecular formula C18H21ClN6O2S
and a molecular weight of 420.93 g/mol. Its IUPAC name is 4-aminobenzenesulfonamide;5-(4-chlorophenyl)-6-ethylpyrimidine-2,4-diamine.
Molecular Properties
| Compound Name | 4-aminobenzenesulfonamide;5-(4-chlorophenyl)-6-ethylpyrimidine-2,4-diamine |
| PubChem CID | 70020180 |
| Molecular Formula | C18H21ClN6O2S |
| Molecular Weight | 420.93 g/mol |
| Exact Mass | 420.11 |
| IUPAC Name | 4-aminobenzenesulfonamide;5-(4-chlorophenyl)-6-ethylpyrimidine-2,4-diamine |
| SMILES | CCc1nc(N)nc(N)c1-c1ccc(Cl)cc1.Nc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C12H13ClN4.C6H8N2O2S/c1-2-9-10(11(14)17-12(15)16-9)7-3-5-8(13)6-4-7;7-5-1-3-6(4-2-5)11(8,9)10/h3-6H,2H2,1H3,(H4,14,15,16,17);1-4H,7H2,(H2,8,9,10) |
| InChIKey | NXUWSWZJWODYHZ-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 164.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 420.93 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-aminobenzenesulfonamide;5-(4-chlorophenyl)-6-ethylpyrimidine-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-aminobenzenesulfonamide;5-(4-chlorophenyl)-6-ethylpyrimidine-2,4-diamine?
The IUPAC name of 4-aminobenzenesulfonamide;5-(4-chlorophenyl)-6-ethylpyrimidine-2,4-diamine (CID 70020180) is 4-aminobenzenesulfonamide;5-(4-chlorophenyl)-6-ethylpyrimidine-2,4-diamine.
What is the SMILES notation for 4-aminobenzenesulfonamide;5-(4-chlorophenyl)-6-ethylpyrimidine-2,4-diamine?
The canonical SMILES for 4-aminobenzenesulfonamide;5-(4-chlorophenyl)-6-ethylpyrimidine-2,4-diamine is CCc1nc(N)nc(N)c1-c1ccc(Cl)cc1.Nc1ccc(S(N)(=O)=O)cc1.
What is the InChIKey of 4-aminobenzenesulfonamide;5-(4-chlorophenyl)-6-ethylpyrimidine-2,4-diamine?
The InChIKey is NXUWSWZJWODYHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13ClN4.C6H8N2O2S/c1-2-9-10(11(14)17-12(15)16-9)7-3-5-8(13)6-4-7;7-5-1-3-6(4-2-5)11(8,9)10/h3-6H,2H2,1H3,(H4,14,15,16,17);1-4H,7H2,(H2,8,9,10).
What are the key properties of 4-aminobenzenesulfonamide;5-(4-chlorophenyl)-6-ethylpyrimidine-2,4-diamine?
4-aminobenzenesulfonamide;5-(4-chlorophenyl)-6-ethylpyrimidine-2,4-diamine has a molecular weight of 420.93 g/mol, XLogP of 2.44, 3 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-aminobenzenesulfonamide;5-(4-chlorophenyl)-6-ethylpyrimidine-2,4-diamine is sourced from PubChem (CID 70020180), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).