C21H27N3 — CID 70020317
2,4,6-tri(cyclohex-2-en-1-yl)-1,3,5-triazine (PubChem CID 70020317) has the molecular formula C21H27N3 and a molecular weight of 321.47 g/mol. Its IUPAC name is 2,4,6-tri(cyclohex-2-en-1-yl)-1,3,5-triazine.
| Compound Name | 2,4,6-tri(cyclohex-2-en-1-yl)-1,3,5-triazine |
|---|---|
| PubChem CID | 70020317 |
| Molecular Formula | C21H27N3 |
| Molecular Weight | 321.47 g/mol |
| Exact Mass | 321.22 |
| IUPAC Name | 2,4,6-tri(cyclohex-2-en-1-yl)-1,3,5-triazine |
| SMILES | C1=CC(c2nc(C3C=CCCC3)nc(C3C=CCCC3)n2)CCC1 |
| InChI | InChI=1S/C21H27N3/c1-4-10-16(11-5-1)19-22-20(17-12-6-2-7-13-17)24-21(23-19)18-14-8-3-9-15-18/h4,6,8,10,12,14,16-18H,1-3,5,7,9,11,13,15H2 |
| InChIKey | MLYVKKJKXMYKFX-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.47 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|