About 2-(4-fluorooctyl)-N,N-dimethylaniline
2-(4-fluorooctyl)-N,N-dimethylaniline (PubChem CID 70020321) has the molecular formula C16H26FN
and a molecular weight of 251.39 g/mol. Its IUPAC name is 2-(4-fluorooctyl)-N,N-dimethylaniline.
Molecular Properties
| Compound Name | 2-(4-fluorooctyl)-N,N-dimethylaniline |
| PubChem CID | 70020321 |
| Molecular Formula | C16H26FN |
| Molecular Weight | 251.39 g/mol |
| Exact Mass | 251.20 |
| IUPAC Name | 2-(4-fluorooctyl)-N,N-dimethylaniline |
| SMILES | CCCCC(F)CCCc1ccccc1N(C)C |
| InChI | InChI=1S/C16H26FN/c1-4-5-11-15(17)12-8-10-14-9-6-7-13-16(14)18(2)3/h6-7,9,13,15H,4-5,8,10-12H2,1-3H3 |
| InChIKey | KZJORVDHQXWIGI-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.39 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(4-fluorooctyl)-N,N-dimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-fluorooctyl)-N,N-dimethylaniline?
The IUPAC name of 2-(4-fluorooctyl)-N,N-dimethylaniline (CID 70020321) is 2-(4-fluorooctyl)-N,N-dimethylaniline.
What is the SMILES notation for 2-(4-fluorooctyl)-N,N-dimethylaniline?
The canonical SMILES for 2-(4-fluorooctyl)-N,N-dimethylaniline is CCCCC(F)CCCc1ccccc1N(C)C.
What is the InChIKey of 2-(4-fluorooctyl)-N,N-dimethylaniline?
The InChIKey is KZJORVDHQXWIGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26FN/c1-4-5-11-15(17)12-8-10-14-9-6-7-13-16(14)18(2)3/h6-7,9,13,15H,4-5,8,10-12H2,1-3H3.
What are the key properties of 2-(4-fluorooctyl)-N,N-dimethylaniline?
2-(4-fluorooctyl)-N,N-dimethylaniline has a molecular weight of 251.39 g/mol, XLogP of 4.60, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-fluorooctyl)-N,N-dimethylaniline is sourced from PubChem (CID 70020321), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).