About 1-fluoro-4-methyl-5-nitro-N-phenyl-N-propan-2-ylcyclohexa-2,4-diene-1-sulfonamide
1-fluoro-4-methyl-5-nitro-N-phenyl-N-propan-2-ylcyclohexa-2,4-diene-1-sulfonamide (PubChem CID 70020430) has the molecular formula C16H19FN2O4S
and a molecular weight of 354.40 g/mol. Its IUPAC name is 1-fluoro-4-methyl-5-nitro-N-phenyl-N-propan-2-ylcyclohexa-2,4-diene-1-sulfonamide.
Molecular Properties
| Compound Name | 1-fluoro-4-methyl-5-nitro-N-phenyl-N-propan-2-ylcyclohexa-2,4-diene-1-sulfonamide |
| PubChem CID | 70020430 |
| Molecular Formula | C16H19FN2O4S |
| Molecular Weight | 354.40 g/mol |
| Exact Mass | 354.10 |
| IUPAC Name | 1-fluoro-4-methyl-5-nitro-N-phenyl-N-propan-2-ylcyclohexa-2,4-diene-1-sulfonamide |
| SMILES | CC1=C([N+](=O)[O-])CC(F)(S(=O)(=O)N(c2ccccc2)C(C)C)C=C1 |
| InChI | InChI=1S/C16H19FN2O4S/c1-12(2)18(14-7-5-4-6-8-14)24(22,23)16(17)10-9-13(3)15(11-16)19(20)21/h4-10,12H,11H2,1-3H3 |
| InChIKey | DSZPWYIZSNYDOR-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.40 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-fluoro-4-methyl-5-nitro-N-phenyl-N-propan-2-ylcyclohexa-2,4-diene-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-fluoro-4-methyl-5-nitro-N-phenyl-N-propan-2-ylcyclohexa-2,4-diene-1-sulfonamide?
The IUPAC name of 1-fluoro-4-methyl-5-nitro-N-phenyl-N-propan-2-ylcyclohexa-2,4-diene-1-sulfonamide (CID 70020430) is 1-fluoro-4-methyl-5-nitro-N-phenyl-N-propan-2-ylcyclohexa-2,4-diene-1-sulfonamide.
What is the SMILES notation for 1-fluoro-4-methyl-5-nitro-N-phenyl-N-propan-2-ylcyclohexa-2,4-diene-1-sulfonamide?
The canonical SMILES for 1-fluoro-4-methyl-5-nitro-N-phenyl-N-propan-2-ylcyclohexa-2,4-diene-1-sulfonamide is CC1=C([N+](=O)[O-])CC(F)(S(=O)(=O)N(c2ccccc2)C(C)C)C=C1.
What is the InChIKey of 1-fluoro-4-methyl-5-nitro-N-phenyl-N-propan-2-ylcyclohexa-2,4-diene-1-sulfonamide?
The InChIKey is DSZPWYIZSNYDOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19FN2O4S/c1-12(2)18(14-7-5-4-6-8-14)24(22,23)16(17)10-9-13(3)15(11-16)19(20)21/h4-10,12H,11H2,1-3H3.
What are the key properties of 1-fluoro-4-methyl-5-nitro-N-phenyl-N-propan-2-ylcyclohexa-2,4-diene-1-sulfonamide?
1-fluoro-4-methyl-5-nitro-N-phenyl-N-propan-2-ylcyclohexa-2,4-diene-1-sulfonamide has a molecular weight of 354.40 g/mol, XLogP of 3.41, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-fluoro-4-methyl-5-nitro-N-phenyl-N-propan-2-ylcyclohexa-2,4-diene-1-sulfonamide is sourced from PubChem (CID 70020430), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).