C32H30ClFN4O6S — CID 70020498
ethyl 2-[5-[[benzyl(methyl)amino]methyl]-1-[(2-fluorophenyl)methyl]-6-(4-nitrophenyl)-2,4-dioxothieno[2,3-d]pyrimidin-3-yl]acetate;hydrochloride (PubChem CID 70020498) has the molecular formula C32H30ClFN4O6S and a molecular weight of 653.13 g/mol. Its IUPAC name is ethyl 2-[5-[[benzyl(methyl)amino]methyl]-1-[(2-fluorophenyl)methyl]-6-(4-nitrophenyl)-2,4-dioxothieno[2,3-d]pyrimidin-3-yl]acetate;hydrochloride.
| Compound Name | ethyl 2-[5-[[benzyl(methyl)amino]methyl]-1-[(2-fluorophenyl)methyl]-6-(4-nitrophenyl)-2,4-dioxothieno[2,3-d]pyrimidin-3-yl]acetate;hydrochloride |
|---|---|
| PubChem CID | 70020498 |
| Molecular Formula | C32H30ClFN4O6S |
| Molecular Weight | 653.13 g/mol |
| Exact Mass | 652.16 |
| IUPAC Name | ethyl 2-[5-[[benzyl(methyl)amino]methyl]-1-[(2-fluorophenyl)methyl]-6-(4-nitrophenyl)-2,4-dioxothieno[2,3-d]pyrimidin-3-yl]acetate;hydrochloride |
| SMILES | CCOC(=O)Cn1c(=O)c2c(CN(C)Cc3ccccc3)c(-c3ccc([N+](=O)[O-])cc3)sc2n(Cc2ccccc2F)c1=O.Cl |
| InChI | InChI=1S/C32H29FN4O6S.ClH/c1-3-43-27(38)20-35-30(39)28-25(19-34(2)17-21-9-5-4-6-10-21)29(22-13-15-24(16-14-22)37(41)42)44-31(28)36(32(35)40)18-23-11-7-8-12-26(23)33;/h4-16H,3,17-20H2,1-2H3;1H |
| InChIKey | UDIRGHLSIDCDQQ-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 116.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.13 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|