C16H25N3OS — CID 70020544
2-butylimino-3-(3-propan-2-ylphenyl)-1,3,5-thiadiazinan-4-ol (PubChem CID 70020544) has the molecular formula C16H25N3OS and a molecular weight of 307.46 g/mol. Its IUPAC name is 2-butylimino-3-(3-propan-2-ylphenyl)-1,3,5-thiadiazinan-4-ol.
| Compound Name | 2-butylimino-3-(3-propan-2-ylphenyl)-1,3,5-thiadiazinan-4-ol |
|---|---|
| PubChem CID | 70020544 |
| Molecular Formula | C16H25N3OS |
| Molecular Weight | 307.46 g/mol |
| Exact Mass | 307.17 |
| IUPAC Name | 2-butylimino-3-(3-propan-2-ylphenyl)-1,3,5-thiadiazinan-4-ol |
| SMILES | CCCC/N=C1\SCNC(O)N1c1cccc(C(C)C)c1 |
| InChI | InChI=1S/C16H25N3OS/c1-4-5-9-17-16-19(15(20)18-11-21-16)14-8-6-7-13(10-14)12(2)3/h6-8,10,12,15,18,20H,4-5,9,11H2,1-3H3/b17-16- |
| InChIKey | JBFLOCFZCAUBAD-MSUUIHNZSA-N |
| XLogP | 3.34 |
| TPSA | 47.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.46 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|