C13H12NO7S- — CID 7002075
(3R,9bR)-6,7-dimethoxy-1,1,5-trioxo-3,9b-dihydro-2H-[1,3]thiazolo[2,3-a]isoindole-3-carboxylate (PubChem CID 7002075) has the molecular formula C13H12NO7S- and a molecular weight of 326.31 g/mol. Its IUPAC name is (3R,9bR)-6,7-dimethoxy-1,1,5-trioxo-3,9b-dihydro-2H-[1,3]thiazolo[2,3-a]isoindole-3-carboxylate.
| Compound Name | (3R,9bR)-6,7-dimethoxy-1,1,5-trioxo-3,9b-dihydro-2H-[1,3]thiazolo[2,3-a]isoindole-3-carboxylate |
|---|---|
| PubChem CID | 7002075 |
| Molecular Formula | C13H12NO7S- |
| Molecular Weight | 326.31 g/mol |
| Exact Mass | 326.03 |
| IUPAC Name | (3R,9bR)-6,7-dimethoxy-1,1,5-trioxo-3,9b-dihydro-2H-[1,3]thiazolo[2,3-a]isoindole-3-carboxylate |
| SMILES | COc1ccc2c(c1OC)C(=O)N1[C@@H]2S(=O)(=O)C[C@H]1C(=O)[O-] |
| InChI | InChI=1S/C13H13NO7S/c1-20-8-4-3-6-9(10(8)21-2)11(15)14-7(13(16)17)5-22(18,19)12(6)14/h3-4,7,12H,5H2,1-2H3,(H,16,17)/p-1/t7-,12+/m0/s1 |
| InChIKey | LXVXOKPTNPHRQT-JVXZTZIISA-M |
| XLogP | -1.29 |
| TPSA | 113.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.31 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |