C16H28Cl2N2O2 — CID 70021699
(3S,4R)-3-(3,4-diethoxyphenyl)-1-methylpiperidin-4-amine;dihydrochloride (PubChem CID 70021699) has the molecular formula C16H28Cl2N2O2 and a molecular weight of 351.32 g/mol. Its IUPAC name is (3S,4R)-3-(3,4-diethoxyphenyl)-1-methylpiperidin-4-amine;dihydrochloride.
| Compound Name | (3S,4R)-3-(3,4-diethoxyphenyl)-1-methylpiperidin-4-amine;dihydrochloride |
|---|---|
| PubChem CID | 70021699 |
| Molecular Formula | C16H28Cl2N2O2 |
| Molecular Weight | 351.32 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | (3S,4R)-3-(3,4-diethoxyphenyl)-1-methylpiperidin-4-amine;dihydrochloride |
| SMILES | CCOc1ccc([C@H]2CN(C)CC[C@H]2N)cc1OCC.Cl.Cl |
| InChI | InChI=1S/C16H26N2O2.2ClH/c1-4-19-15-7-6-12(10-16(15)20-5-2)13-11-18(3)9-8-14(13)17;;/h6-7,10,13-14H,4-5,8-9,11,17H2,1-3H3;2*1H/t13-,14-;;/m1../s1 |
| InChIKey | BWYRUGYLRJXRFN-KFWOVWKUSA-N |
| XLogP | 3.07 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.32 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |