C14H20N2O6S2 — CID 70021749
(2S,5R,6R)-6-amino-2-[3-(2-carboxyethylsulfanyl)propanoyl]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid (PubChem CID 70021749) has the molecular formula C14H20N2O6S2 and a molecular weight of 376.46 g/mol. Its IUPAC name is (2S,5R,6R)-6-amino-2-[3-(2-carboxyethylsulfanyl)propanoyl]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid.
| Compound Name | (2S,5R,6R)-6-amino-2-[3-(2-carboxyethylsulfanyl)propanoyl]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 70021749 |
| Molecular Formula | C14H20N2O6S2 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.08 |
| IUPAC Name | (2S,5R,6R)-6-amino-2-[3-(2-carboxyethylsulfanyl)propanoyl]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
| SMILES | CC1(C)S[C@@H]2[C@H](N)C(=O)N2[C@]1(C(=O)O)C(=O)CCSCCC(=O)O |
| InChI | InChI=1S/C14H20N2O6S2/c1-13(2)14(12(21)22,16-10(20)9(15)11(16)24-13)7(17)3-5-23-6-4-8(18)19/h9,11H,3-6,15H2,1-2H3,(H,18,19)(H,21,22)/t9-,11-,14+/m1/s1 |
| InChIKey | LYZKAXXFXSCSOY-UDZFHETQSA-N |
| XLogP | -0.00 |
| TPSA | 138.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|