About 2-[4-(2-butyl-1-benzofuran-3-yl)-2,6-diiodophenoxy]acetic acid
2-[4-(2-butyl-1-benzofuran-3-yl)-2,6-diiodophenoxy]acetic acid (PubChem CID 70021914) has the molecular formula C20H18I2O4
and a molecular weight of 576.17 g/mol. Its IUPAC name is 2-[4-(2-butyl-1-benzofuran-3-yl)-2,6-diiodophenoxy]acetic acid.
Molecular Properties
| Compound Name | 2-[4-(2-butyl-1-benzofuran-3-yl)-2,6-diiodophenoxy]acetic acid |
| PubChem CID | 70021914 |
| Molecular Formula | C20H18I2O4 |
| Molecular Weight | 576.17 g/mol |
| Exact Mass | 575.93 |
| IUPAC Name | 2-[4-(2-butyl-1-benzofuran-3-yl)-2,6-diiodophenoxy]acetic acid |
| SMILES | CCCCc1oc2ccccc2c1-c1cc(I)c(OCC(=O)O)c(I)c1 |
| InChI | InChI=1S/C20H18I2O4/c1-2-3-7-17-19(13-6-4-5-8-16(13)26-17)12-9-14(21)20(15(22)10-12)25-11-18(23)24/h4-6,8-10H,2-3,7,11H2,1H3,(H,23,24) |
| InChIKey | RGBYLQVCBZJJPE-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 59.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 576.17 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-(2-butyl-1-benzofuran-3-yl)-2,6-diiodophenoxy]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(2-butyl-1-benzofuran-3-yl)-2,6-diiodophenoxy]acetic acid?
The IUPAC name of 2-[4-(2-butyl-1-benzofuran-3-yl)-2,6-diiodophenoxy]acetic acid (CID 70021914) is 2-[4-(2-butyl-1-benzofuran-3-yl)-2,6-diiodophenoxy]acetic acid.
What is the SMILES notation for 2-[4-(2-butyl-1-benzofuran-3-yl)-2,6-diiodophenoxy]acetic acid?
The canonical SMILES for 2-[4-(2-butyl-1-benzofuran-3-yl)-2,6-diiodophenoxy]acetic acid is CCCCc1oc2ccccc2c1-c1cc(I)c(OCC(=O)O)c(I)c1.
What is the InChIKey of 2-[4-(2-butyl-1-benzofuran-3-yl)-2,6-diiodophenoxy]acetic acid?
The InChIKey is RGBYLQVCBZJJPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18I2O4/c1-2-3-7-17-19(13-6-4-5-8-16(13)26-17)12-9-14(21)20(15(22)10-12)25-11-18(23)24/h4-6,8-10H,2-3,7,11H2,1H3,(H,23,24).
What are the key properties of 2-[4-(2-butyl-1-benzofuran-3-yl)-2,6-diiodophenoxy]acetic acid?
2-[4-(2-butyl-1-benzofuran-3-yl)-2,6-diiodophenoxy]acetic acid has a molecular weight of 576.17 g/mol, XLogP of 6.11, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(2-butyl-1-benzofuran-3-yl)-2,6-diiodophenoxy]acetic acid is sourced from PubChem (CID 70021914), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).