About 6,7-dimethoxy-1-phenylspiro[4H-isoquinoline-3,1'-cyclopentane]
6,7-dimethoxy-1-phenylspiro[4H-isoquinoline-3,1'-cyclopentane] (PubChem CID 700221) has the molecular formula C21H23NO2
and a molecular weight of 321.42 g/mol. Its IUPAC name is 6,7-dimethoxy-1-phenylspiro[4H-isoquinoline-3,1'-cyclopentane].
Molecular Properties
| Compound Name | 6,7-dimethoxy-1-phenylspiro[4H-isoquinoline-3,1'-cyclopentane] |
| PubChem CID | 700221 |
| Molecular Formula | C21H23NO2 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | 6,7-dimethoxy-1-phenylspiro[4H-isoquinoline-3,1'-cyclopentane] |
| SMILES | COc1cc2c(cc1OC)C(c1ccccc1)=NC1(CCCC1)C2 |
| InChI | InChI=1S/C21H23NO2/c1-23-18-12-16-14-21(10-6-7-11-21)22-20(15-8-4-3-5-9-15)17(16)13-19(18)24-2/h3-5,8-9,12-13H,6-7,10-11,14H2,1-2H3 |
| InChIKey | BVIFBLQHDFHPFC-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6,7-dimethoxy-1-phenylspiro[4H-isoquinoline-3,1'-cyclopentane] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-dimethoxy-1-phenylspiro[4H-isoquinoline-3,1'-cyclopentane]?
The IUPAC name of 6,7-dimethoxy-1-phenylspiro[4H-isoquinoline-3,1'-cyclopentane] (CID 700221) is 6,7-dimethoxy-1-phenylspiro[4H-isoquinoline-3,1'-cyclopentane].
What is the SMILES notation for 6,7-dimethoxy-1-phenylspiro[4H-isoquinoline-3,1'-cyclopentane]?
The canonical SMILES for 6,7-dimethoxy-1-phenylspiro[4H-isoquinoline-3,1'-cyclopentane] is COc1cc2c(cc1OC)C(c1ccccc1)=NC1(CCCC1)C2.
What is the InChIKey of 6,7-dimethoxy-1-phenylspiro[4H-isoquinoline-3,1'-cyclopentane]?
The InChIKey is BVIFBLQHDFHPFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23NO2/c1-23-18-12-16-14-21(10-6-7-11-21)22-20(15-8-4-3-5-9-15)17(16)13-19(18)24-2/h3-5,8-9,12-13H,6-7,10-11,14H2,1-2H3.
What are the key properties of 6,7-dimethoxy-1-phenylspiro[4H-isoquinoline-3,1'-cyclopentane]?
6,7-dimethoxy-1-phenylspiro[4H-isoquinoline-3,1'-cyclopentane] has a molecular weight of 321.42 g/mol, XLogP of 4.41, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-dimethoxy-1-phenylspiro[4H-isoquinoline-3,1'-cyclopentane] is sourced from PubChem (CID 700221), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).