C16H28N2O2 — CID 70022555
N-[(1R,2R,6S)-2-pentan-3-yloxy-6-(prop-2-enylamino)cyclohex-3-en-1-yl]acetamide (PubChem CID 70022555) has the molecular formula C16H28N2O2 and a molecular weight of 280.41 g/mol. Its IUPAC name is N-[(1R,2R,6S)-2-pentan-3-yloxy-6-(prop-2-enylamino)cyclohex-3-en-1-yl]acetamide.
| Compound Name | N-[(1R,2R,6S)-2-pentan-3-yloxy-6-(prop-2-enylamino)cyclohex-3-en-1-yl]acetamide |
|---|---|
| PubChem CID | 70022555 |
| Molecular Formula | C16H28N2O2 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.22 |
| IUPAC Name | N-[(1R,2R,6S)-2-pentan-3-yloxy-6-(prop-2-enylamino)cyclohex-3-en-1-yl]acetamide |
| SMILES | C=CCN[C@H]1CC=C[C@@H](OC(CC)CC)[C@@H]1NC(C)=O |
| InChI | InChI=1S/C16H28N2O2/c1-5-11-17-14-9-8-10-15(16(14)18-12(4)19)20-13(6-2)7-3/h5,8,10,13-17H,1,6-7,9,11H2,2-4H3,(H,18,19)/t14-,15+,16+/m0/s1 |
| InChIKey | LDQWHNGSZMXEQR-ARFHVFGLSA-N |
| XLogP | 2.17 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|