About 1-cyclopenta-1,3-dien-1-yl-N,N-dimethylpropan-1-amine
1-cyclopenta-1,3-dien-1-yl-N,N-dimethylpropan-1-amine (PubChem CID 70022649) has the molecular formula C10H17N
and a molecular weight of 151.25 g/mol. Its IUPAC name is 1-cyclopenta-1,3-dien-1-yl-N,N-dimethylpropan-1-amine.
Molecular Properties
| Compound Name | 1-cyclopenta-1,3-dien-1-yl-N,N-dimethylpropan-1-amine |
| PubChem CID | 70022649 |
| Molecular Formula | C10H17N |
| Molecular Weight | 151.25 g/mol |
| Exact Mass | 151.14 |
| IUPAC Name | 1-cyclopenta-1,3-dien-1-yl-N,N-dimethylpropan-1-amine |
| SMILES | CCC(C1=CC=CC1)N(C)C |
| InChI | InChI=1S/C10H17N/c1-4-10(11(2)3)9-7-5-6-8-9/h5-7,10H,4,8H2,1-3H3 |
| InChIKey | NMTZOVQATSKJRY-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.25 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-cyclopenta-1,3-dien-1-yl-N,N-dimethylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopenta-1,3-dien-1-yl-N,N-dimethylpropan-1-amine?
The IUPAC name of 1-cyclopenta-1,3-dien-1-yl-N,N-dimethylpropan-1-amine (CID 70022649) is 1-cyclopenta-1,3-dien-1-yl-N,N-dimethylpropan-1-amine.
What is the SMILES notation for 1-cyclopenta-1,3-dien-1-yl-N,N-dimethylpropan-1-amine?
The canonical SMILES for 1-cyclopenta-1,3-dien-1-yl-N,N-dimethylpropan-1-amine is CCC(C1=CC=CC1)N(C)C.
What is the InChIKey of 1-cyclopenta-1,3-dien-1-yl-N,N-dimethylpropan-1-amine?
The InChIKey is NMTZOVQATSKJRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N/c1-4-10(11(2)3)9-7-5-6-8-9/h5-7,10H,4,8H2,1-3H3.
What are the key properties of 1-cyclopenta-1,3-dien-1-yl-N,N-dimethylpropan-1-amine?
1-cyclopenta-1,3-dien-1-yl-N,N-dimethylpropan-1-amine has a molecular weight of 151.25 g/mol, XLogP of 2.21, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopenta-1,3-dien-1-yl-N,N-dimethylpropan-1-amine is sourced from PubChem (CID 70022649), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).