C26H16F4N4O3 — CID 70022696
4-[(1S,7S)-8-[4-fluoro-3-(trifluoromethyl)benzoyl]-3,5-dioxo-2,4,8-triazatricyclo[5.2.1.02,6]decan-4-yl]naphthalene-1-carbonitrile (PubChem CID 70022696) has the molecular formula C26H16F4N4O3 and a molecular weight of 508.43 g/mol. Its IUPAC name is 4-[(1S,7S)-8-[4-fluoro-3-(trifluoromethyl)benzoyl]-3,5-dioxo-2,4,8-triazatricyclo[5.2.1.02,6]decan-4-yl]naphthalene-1-carbonitrile.
| Compound Name | 4-[(1S,7S)-8-[4-fluoro-3-(trifluoromethyl)benzoyl]-3,5-dioxo-2,4,8-triazatricyclo[5.2.1.02,6]decan-4-yl]naphthalene-1-carbonitrile |
|---|---|
| PubChem CID | 70022696 |
| Molecular Formula | C26H16F4N4O3 |
| Molecular Weight | 508.43 g/mol |
| Exact Mass | 508.12 |
| IUPAC Name | 4-[(1S,7S)-8-[4-fluoro-3-(trifluoromethyl)benzoyl]-3,5-dioxo-2,4,8-triazatricyclo[5.2.1.02,6]decan-4-yl]naphthalene-1-carbonitrile |
| SMILES | N#Cc1ccc(N2C(=O)C3[C@@H]4C[C@@H](CN4C(=O)c4ccc(F)c(C(F)(F)F)c4)N3C2=O)c2ccccc12 |
| InChI | InChI=1S/C26H16F4N4O3/c27-19-7-5-13(9-18(19)26(28,29)30)23(35)32-12-15-10-21(32)22-24(36)34(25(37)33(15)22)20-8-6-14(11-31)16-3-1-2-4-17(16)20/h1-9,15,21-22H,10,12H2/t15-,21-,22?/m0/s1 |
| InChIKey | CKKPVUOWJGAKIK-NCMGMYTPSA-N |
| XLogP | 4.30 |
| TPSA | 84.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.43 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|