C28H31N2O10P — CID 70022753
methyl 4-[(3aS,4R,6R,6aS)-6-[bis(phenylmethoxy)phosphoryloxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-3-oxopyrazine-2-carboxylate (PubChem CID 70022753) has the molecular formula C28H31N2O10P and a molecular weight of 586.53 g/mol. Its IUPAC name is methyl 4-[(3aS,4R,6R,6aS)-6-[bis(phenylmethoxy)phosphoryloxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-3-oxopyrazine-2-carboxylate.
| Compound Name | methyl 4-[(3aS,4R,6R,6aS)-6-[bis(phenylmethoxy)phosphoryloxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-3-oxopyrazine-2-carboxylate |
|---|---|
| PubChem CID | 70022753 |
| Molecular Formula | C28H31N2O10P |
| Molecular Weight | 586.53 g/mol |
| Exact Mass | 586.17 |
| IUPAC Name | methyl 4-[(3aS,4R,6R,6aS)-6-[bis(phenylmethoxy)phosphoryloxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-3-oxopyrazine-2-carboxylate |
| SMILES | COC(=O)c1nccn([C@@H]2O[C@H](COP(=O)(OCc3ccccc3)OCc3ccccc3)[C@@H]3OC(C)(C)O[C@@H]32)c1=O |
| InChI | InChI=1S/C28H31N2O10P/c1-28(2)39-23-21(38-26(24(23)40-28)30-15-14-29-22(25(30)31)27(32)34-3)18-37-41(33,35-16-19-10-6-4-7-11-19)36-17-20-12-8-5-9-13-20/h4-15,21,23-24,26H,16-18H2,1-3H3/t21-,23+,24+,26-/m1/s1 |
| InChIKey | OZZIMYMDKRTHRV-BPEMXEAKSA-N |
| XLogP | 4.01 |
| TPSA | 133.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.53 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|