C25H24ClN3 — CID 70023341
6-[[2-(6-chloro-1H-indol-3-yl)-3,6-dihydro-2H-pyridin-1-yl]methyl]-1,6,7,8-tetrahydrocyclopenta[g]indole (PubChem CID 70023341) has the molecular formula C25H24ClN3 and a molecular weight of 401.94 g/mol. Its IUPAC name is 6-[[2-(6-chloro-1H-indol-3-yl)-3,6-dihydro-2H-pyridin-1-yl]methyl]-1,6,7,8-tetrahydrocyclopenta[g]indole.
| Compound Name | 6-[[2-(6-chloro-1H-indol-3-yl)-3,6-dihydro-2H-pyridin-1-yl]methyl]-1,6,7,8-tetrahydrocyclopenta[g]indole |
|---|---|
| PubChem CID | 70023341 |
| Molecular Formula | C25H24ClN3 |
| Molecular Weight | 401.94 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | 6-[[2-(6-chloro-1H-indol-3-yl)-3,6-dihydro-2H-pyridin-1-yl]methyl]-1,6,7,8-tetrahydrocyclopenta[g]indole |
| SMILES | Clc1ccc2c(C3CC=CCN3CC3CCc4c3ccc3cc[nH]c43)c[nH]c2c1 |
| InChI | InChI=1S/C25H24ClN3/c26-18-6-9-20-22(14-28-23(20)13-18)24-3-1-2-12-29(24)15-17-5-8-21-19(17)7-4-16-10-11-27-25(16)21/h1-2,4,6-7,9-11,13-14,17,24,27-28H,3,5,8,12,15H2 |
| InChIKey | WOLJJAPMOQXGLE-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 34.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.94 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|