About 1-hydroxy-2,5-dihydrocyclopenta[b]pyridine
1-hydroxy-2,5-dihydrocyclopenta[b]pyridine (PubChem CID 70023370) has the molecular formula C8H9NO
and a molecular weight of 135.17 g/mol. Its IUPAC name is 1-hydroxy-2,5-dihydrocyclopenta[b]pyridine.
Molecular Properties
| Compound Name | 1-hydroxy-2,5-dihydrocyclopenta[b]pyridine |
| PubChem CID | 70023370 |
| Molecular Formula | C8H9NO |
| Molecular Weight | 135.17 g/mol |
| Exact Mass | 135.07 |
| IUPAC Name | 1-hydroxy-2,5-dihydrocyclopenta[b]pyridine |
| SMILES | ON1CC=CC2=C1C=CC2 |
| InChI | InChI=1S/C8H9NO/c10-9-6-2-4-7-3-1-5-8(7)9/h1-2,4-5,10H,3,6H2 |
| InChIKey | GIZUJHWILQFXDV-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.17 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-hydroxy-2,5-dihydrocyclopenta[b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hydroxy-2,5-dihydrocyclopenta[b]pyridine?
The IUPAC name of 1-hydroxy-2,5-dihydrocyclopenta[b]pyridine (CID 70023370) is 1-hydroxy-2,5-dihydrocyclopenta[b]pyridine.
What is the SMILES notation for 1-hydroxy-2,5-dihydrocyclopenta[b]pyridine?
The canonical SMILES for 1-hydroxy-2,5-dihydrocyclopenta[b]pyridine is ON1CC=CC2=C1C=CC2.
What is the InChIKey of 1-hydroxy-2,5-dihydrocyclopenta[b]pyridine?
The InChIKey is GIZUJHWILQFXDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO/c10-9-6-2-4-7-3-1-5-8(7)9/h1-2,4-5,10H,3,6H2.
What are the key properties of 1-hydroxy-2,5-dihydrocyclopenta[b]pyridine?
1-hydroxy-2,5-dihydrocyclopenta[b]pyridine has a molecular weight of 135.17 g/mol, XLogP of 1.46, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hydroxy-2,5-dihydrocyclopenta[b]pyridine is sourced from PubChem (CID 70023370), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).