C27H49N5O4S — CID 70023467
butyl N-[(2S)-3-butylsulfanyl-1-[(2S)-2-[(4-carbamimidoylcyclohexyl)methylcarbamoyl]pyrrolidin-1-yl]-3-methyl-1-oxobutan-2-yl]carbamate (PubChem CID 70023467) has the molecular formula C27H49N5O4S and a molecular weight of 539.79 g/mol. Its IUPAC name is butyl N-[(2S)-3-butylsulfanyl-1-[(2S)-2-[(4-carbamimidoylcyclohexyl)methylcarbamoyl]pyrrolidin-1-yl]-3-methyl-1-oxobutan-2-yl]carbamate.
| Compound Name | butyl N-[(2S)-3-butylsulfanyl-1-[(2S)-2-[(4-carbamimidoylcyclohexyl)methylcarbamoyl]pyrrolidin-1-yl]-3-methyl-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 70023467 |
| Molecular Formula | C27H49N5O4S |
| Molecular Weight | 539.79 g/mol |
| Exact Mass | 539.35 |
| IUPAC Name | butyl N-[(2S)-3-butylsulfanyl-1-[(2S)-2-[(4-carbamimidoylcyclohexyl)methylcarbamoyl]pyrrolidin-1-yl]-3-methyl-1-oxobutan-2-yl]carbamate |
| SMILES | [H]/N=C(\N)C1CCC(CNC(=O)[C@@H]2CCCN2C(=O)[C@H](NC(=O)OCCCC)C(C)(C)SCCCC)CC1 |
| InChI | InChI=1S/C27H49N5O4S/c1-5-7-16-36-26(35)31-22(27(3,4)37-17-8-6-2)25(34)32-15-9-10-21(32)24(33)30-18-19-11-13-20(14-12-19)23(28)29/h19-22H,5-18H2,1-4H3,(H3,28,29)(H,30,33)(H,31,35)/t19?,20?,21-,22-/m0/s1 |
| InChIKey | RXEIMXOHOTTZLU-UJKMTWAASA-N |
| XLogP | 4.04 |
| TPSA | 137.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.79 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|