About (2S)-1-N-[5-(3-methylphenyl)-4-pyridin-4-ylpyrimidin-2-yl]-3-phenylpropane-1,2-diamine
(2S)-1-N-[5-(3-methylphenyl)-4-pyridin-4-ylpyrimidin-2-yl]-3-phenylpropane-1,2-diamine (PubChem CID 70023723) has the molecular formula C25H25N5
and a molecular weight of 395.51 g/mol. Its IUPAC name is (2S)-1-N-[5-(3-methylphenyl)-4-pyridin-4-ylpyrimidin-2-yl]-3-phenylpropane-1,2-diamine.
Molecular Properties
| Compound Name | (2S)-1-N-[5-(3-methylphenyl)-4-pyridin-4-ylpyrimidin-2-yl]-3-phenylpropane-1,2-diamine |
| PubChem CID | 70023723 |
| Molecular Formula | C25H25N5 |
| Molecular Weight | 395.51 g/mol |
| Exact Mass | 395.21 |
| IUPAC Name | (2S)-1-N-[5-(3-methylphenyl)-4-pyridin-4-ylpyrimidin-2-yl]-3-phenylpropane-1,2-diamine |
| SMILES | Cc1cccc(-c2cnc(NC[C@@H](N)Cc3ccccc3)nc2-c2ccncc2)c1 |
| InChI | InChI=1S/C25H25N5/c1-18-6-5-9-21(14-18)23-17-29-25(30-24(23)20-10-12-27-13-11-20)28-16-22(26)15-19-7-3-2-4-8-19/h2-14,17,22H,15-16,26H2,1H3,(H,28,29,30)/t22-/m0/s1 |
| InChIKey | XPMCPFMKOICLQX-QFIPXVFZSA-N |
| XLogP | 4.50 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 395.51 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2S)-1-N-[5-(3-methylphenyl)-4-pyridin-4-ylpyrimidin-2-yl]-3-phenylpropane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-1-N-[5-(3-methylphenyl)-4-pyridin-4-ylpyrimidin-2-yl]-3-phenylpropane-1,2-diamine?
The IUPAC name of (2S)-1-N-[5-(3-methylphenyl)-4-pyridin-4-ylpyrimidin-2-yl]-3-phenylpropane-1,2-diamine (CID 70023723) is (2S)-1-N-[5-(3-methylphenyl)-4-pyridin-4-ylpyrimidin-2-yl]-3-phenylpropane-1,2-diamine.
What is the SMILES notation for (2S)-1-N-[5-(3-methylphenyl)-4-pyridin-4-ylpyrimidin-2-yl]-3-phenylpropane-1,2-diamine?
The canonical SMILES for (2S)-1-N-[5-(3-methylphenyl)-4-pyridin-4-ylpyrimidin-2-yl]-3-phenylpropane-1,2-diamine is Cc1cccc(-c2cnc(NC[C@@H](N)Cc3ccccc3)nc2-c2ccncc2)c1.
What is the InChIKey of (2S)-1-N-[5-(3-methylphenyl)-4-pyridin-4-ylpyrimidin-2-yl]-3-phenylpropane-1,2-diamine?
The InChIKey is XPMCPFMKOICLQX-QFIPXVFZSA-N. The full InChI is InChI=1S/C25H25N5/c1-18-6-5-9-21(14-18)23-17-29-25(30-24(23)20-10-12-27-13-11-20)28-16-22(26)15-19-7-3-2-4-8-19/h2-14,17,22H,15-16,26H2,1H3,(H,28,29,30)/t22-/m0/s1.
What are the key properties of (2S)-1-N-[5-(3-methylphenyl)-4-pyridin-4-ylpyrimidin-2-yl]-3-phenylpropane-1,2-diamine?
(2S)-1-N-[5-(3-methylphenyl)-4-pyridin-4-ylpyrimidin-2-yl]-3-phenylpropane-1,2-diamine has a molecular weight of 395.51 g/mol, XLogP of 4.50, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-1-N-[5-(3-methylphenyl)-4-pyridin-4-ylpyrimidin-2-yl]-3-phenylpropane-1,2-diamine is sourced from PubChem (CID 70023723), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).