C33H54N4O2 — CID 70023756
1-(2-amino-2-butylhexyl)-3-(4-butylphenyl)-1-[[4-[3-(dimethylamino)propoxy]phenyl]methyl]urea (PubChem CID 70023756) has the molecular formula C33H54N4O2 and a molecular weight of 538.82 g/mol. Its IUPAC name is 1-(2-amino-2-butylhexyl)-3-(4-butylphenyl)-1-[[4-[3-(dimethylamino)propoxy]phenyl]methyl]urea.
| Compound Name | 1-(2-amino-2-butylhexyl)-3-(4-butylphenyl)-1-[[4-[3-(dimethylamino)propoxy]phenyl]methyl]urea |
|---|---|
| PubChem CID | 70023756 |
| Molecular Formula | C33H54N4O2 |
| Molecular Weight | 538.82 g/mol |
| Exact Mass | 538.42 |
| IUPAC Name | 1-(2-amino-2-butylhexyl)-3-(4-butylphenyl)-1-[[4-[3-(dimethylamino)propoxy]phenyl]methyl]urea |
| SMILES | CCCCc1ccc(NC(=O)N(Cc2ccc(OCCCN(C)C)cc2)CC(N)(CCCC)CCCC)cc1 |
| InChI | InChI=1S/C33H54N4O2/c1-6-9-13-28-14-18-30(19-15-28)35-32(38)37(27-33(34,22-10-7-2)23-11-8-3)26-29-16-20-31(21-17-29)39-25-12-24-36(4)5/h14-21H,6-13,22-27,34H2,1-5H3,(H,35,38) |
| InChIKey | SALQUVFNCKUMEL-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.82 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|